| Sitemap | 
                    
                    
                    
                        | 1. Cable Connector & Component Series | 
                    
                    
                    
                        | 2. Fastener & Component Series | 
                    
                    
                    
                        | 3. Electronic Stamping Parts | 
                    
                    
                    
                        | 4. Valve & Component Series | 
                    
                    
                    
                        | 5. Explosion-Proof Series | 
                    
                    
                    
                        | 6. Vacuum Circuit Breaker & Component Series | 
                    
                    
                    
                        | 7. Application | 
                    
                    
                    
                        | 8. Home | 
                    
                    
                    
                        | 9. About Us | 
                    
                    
                    
                        | 10. Products | 
                    
                    
                    
                        | 11. Factory Tour | 
                    
                    
                    
                        | 12. Certificates | 
                    
                    
                    
                        | 13. Our Advantage | 
                    
                    
                    
                        | 14. Contact Us | 
                    
                    
                    
                        | 15. Cable Connector & Component Series | 
                    
                    
                    
                        | 16. Copper Lug | 
                    
                    
                    
                        | 17. Bimetallic Lug | 
                    
                    
                    
                        | 18. Bolted Bimetallic Connector | 
                    
                    
                    
                        | 19. Parallel Groove Clamp | 
                    
                    
                    
                        | 20. Pre Insulated Bimetal Connector | 
                    
                    
                    
                        | 21. Aluminium Solderless Terminal | 
                    
                    
                    
                        | 22. Dead End Clamp | 
                    
                    
                    
                        | 23. Suspension Clamp | 
                    
                    
                    
                        | 24. Anchor Clamp Bracket | 
                    
                    
                    
                        | 25. Metal Parts | 
                    
                    
                    
                        | 26. Aerial Bundle Cable Accessory | 
                    
                    
                    
                        | 27. Insulation Piercing Connector Jbc | 
                    
                    
                    
                        | 28. Suspension Clamp(XJ) | 
                    
                    
                    
                        | 29. Plastic Anchor Clamp | 
                    
                    
                    
                        | 30. Metal Anchor Clamp | 
                    
                    
                    
                        | 31. Dead End Clamp | 
                    
                    
                    
                        | 32. Suspension Clamp | 
                    
                    
                    
                        | 33. Anchor Bracket | 
                    
                    
                    
                        | 34. Line Fitting(Copper Aluminium) | 
                    
                    
                    
                        | 35. Grounding System Series | 
                    
                    
                    
                        | 36. Earthing Rod | 
                    
                    
                    
                        | 37. Parts & Accessories | 
                    
                    
                    
                        | 38. Lightning Protection | 
                    
                    
                    
                        | 39. Earth Bar | 
                    
                    
                    
                        | 40. Tape & Cable | 
                    
                    
                    
                        | 41. Exothermic Welding / Inspection Pit | 
                    
                    
                    
                        | 42. Welding Powder And Mold | 
                    
                    
                    
                        | 43. Copper Braided Connector Series | 
                    
                    
                    
                        | 44. Braided Copper Wires | 
                    
                    
                    
                        | 45. Stranded Copper Wires | 
                    
                    
                    
                        | 46. Pneumatic & Component Series | 
                    
                    
                    
                        | 47. Cylinder Components | 
                    
                    
                    
                        | 48. Air Source Treatment | 
                    
                    
                    
                        | 49. Control Component | 
                    
                    
                    
                        | 50. Auxllary Components | 
                    
                    
                    
                        | 51. Hydraulic Components | 
                    
                    
                    
                        | 52. Pneumatic Components | 
                    
                    
                    
                        | 53. KQ Series | 
                    
                    
                    
                        | 54. AS Series | 
                    
                    
                    
                        | 55. AFS Series | 
                    
                    
                    
                        | 56. ASV Series | 
                    
                    
                    
                        | 57. ASN2 Series | 
                    
                    
                    
                        | 58. EV Series | 
                    
                    
                    
                        | 59. ZH Series | 
                    
                    
                    
                        | 60. ZU Series | 
                    
                    
                    
                        | 61. VM Series | 
                    
                    
                    
                        | 62. ZFC Series | 
                    
                    
                    
                        | 63. KS/KX Series | 
                    
                    
                    
                        | 64. VHK Series | 
                    
                    
                    
                        | 65. KJ Series | 
                    
                    
                    
                        | 66. KC Series | 
                    
                    
                    
                        | 67. AKH,AKB Series | 
                    
                    
                    
                        | 68. BV Series | 
                    
                    
                    
                        | 69. B Series | 
                    
                    
                    
                        | 70. PCV Series | 
                    
                    
                    
                        | 71. PHK.PHD Series | 
                    
                    
                    
                        | 72. M Series | 
                    
                    
                    
                        | 73. KM Series | 
                    
                    
                    
                        | 74. Thread Connector Series | 
                    
                    
                    
                        | 75. Muffler Series | 
                    
                    
                    
                        | 76. Machining | 
                    
                    
                    
                        | 77. Fastener & Component Series | 
                    
                    
                    
                        | 78. Bolts | 
                    
                    
                    
                        | 79. 5G Base Station Fittings | 
                    
                    
                    
                        | 80. Auto Door Lock Series | 
                    
                    
                    
                        | 81. Coal machine accessories series | 
                    
                    
                    
                        | 82. Electrical fittings series | 
                    
                    
                    
                        | 83. Energy storage copper parts series | 
                    
                    
                    
                        | 84. Engine oil pipe fittings | 
                    
                    
                    
                        | 85. Multi-position shaped cold heading parts | 
                    
                    
                    
                        | 86. Shaped copper parts series | 
                    
                    
                    
                        | 87. Silicon rectifier copper parts | 
                    
                    
                    
                        | 88. Special-shaped parts series | 
                    
                    
                    
                        | 89. Stainless Steel Series | 
                    
                    
                    
                        | 90. Tube Gasket | 
                    
                    
                    
                        | 91. Nuts | 
                    
                    
                    
                        | 92. Stainless Steel Nut Series | 
                    
                    
                    
                        | 93. Washers | 
                    
                    
                    
                        | 94. Studs | 
                    
                    
                    
                        | 95. Electronic Stamping Parts | 
                    
                    
                    
                        | 96. Electronic stamping parts | 
                    
                    
                    
                        | 97. Metal Parts | 
                    
                    
                    
                        | 98. SS304 Throat Hoop & Component Series | 
                    
                    
                    
                        | 99. Throat Hoop | 
                    
                    
                    
                        | 100. Cable Tie Series | 
                    
                    
                    
                        | 101. Strapping Tool | 
                    
                    
                    
                        | 102. Battery Terminal & Component Series | 
                    
                    
                    
                        | 103. Battery Switch | 
                    
                    
                    
                        | 104. Battery Cable | 
                    
                    
                    
                        | 105. Battery Terminal | 
                    
                    
                    
                        | 106. Booster Cable, Battery Accessories | 
                    
                    
                    
                        | 107. Valve & Component Series | 
                    
                    
                    
                        | 108. Ball Valve Series | 
                    
                    
                    
                        | 109. Radiator Valve Series | 
                    
                    
                    
                        | 110. Manifolds | 
                    
                    
                    
                        | 111. Gate Valve Series | 
                    
                    
                    
                        | 112. Check Valve Series | 
                    
                    
                    
                        | 113. Angle Valve Series | 
                    
                    
                    
                        | 114. Bibcock Series | 
                    
                    
                    
                        | 115. Hose | 
                    
                    
                    
                        | 116. Braided Hose Series | 
                    
                    
                    
                        | 117. Stainless Steel Wire Braided Hose | 
                    
                    
                    
                        | 118. Nylon/PET Wire Braided Hose | 
                    
                    
                    
                        | 119. Reinforced PVC Hose | 
                    
                    
                    
                        | 120. Polymer Braided Hose | 
                    
                    
                    
                        | 121. Multi-layer High Pressure Hose | 
                    
                    
                    
                        | 122. Valve Flexible Water Connect | 
                    
                    
                    
                        | 123. Kitchen Pull-Out Hose Series | 
                    
                    
                    
                        | 124. Classic Pull-Out Series | 
                    
                    
                    
                        | 125. Universal Pull-Out Hose | 
                    
                    
                    
                        | 126. Bidet Sprayer Hose Series | 
                    
                    
                    
                        | 127. Washing Machine Hose Series | 
                    
                    
                    
                        | 128. Water Heater Connector Series | 
                    
                    
                    
                        | 129. Stainless Steel Shower Hose Series | 
                    
                    
                    
                        | 130. PVC Antibacterial Shower Hose Series | 
                    
                    
                    
                        | 131. Smart Toilet Connector Series | 
                    
                    
                    
                        | 132. Stainless Steel Corrugated Hose Series | 
                    
                    
                    
                        | 133. Gas Hose | 
                    
                    
                    
                        | 134. Explosion-Proof Series | 
                    
                    
                    
                        | 135. Explosion-proof Light | 
                    
                    
                    
                        | 136. LED Explosion-proof Light Series | 
                    
                    
                    
                        | 137. Fixed Explosion-proof Light Series | 
                    
                    
                    
                        | 138. Portable Explosion-proof Light Series | 
                    
                    
                    
                        | 139. Professional Light | 
                    
                    
                    
                        | 140. LED Professional Light Series | 
                    
                    
                    
                        | 141. Fixed Professional Light Series | 
                    
                    
                    
                        | 142. Portable Professional Light Series | 
                    
                    
                    
                        | 143. Explosion-proof Boxes & Other Electrical Appliances | 
                    
                    
                    
                        | 144. Explosion-proof Electrical Appliances Series | 
                    
                    
                    
                        | 145. Explosion-proof And Anti-corrosion Series | 
                    
                    
                    
                        | 146. Explosion-proof Pipe Fittings Series | 
                    
                    
                    
                        | 147. Explosion-proof Fan | 
                    
                    
                    
                        | 148. Distribution Boxes & Component Series | 
                    
                    
                    
                        | 149. Electrical Cabinets and Boxes | 
                    
                    
                    
                        | 150. Metal Boxes | 
                    
                    
                    
                        | 151. Explosion-proof Boxes and Enclosures | 
                    
                    
                    
                        | 152. Aluminum Box | 
                    
                    
                    
                        | 153. Vacuum Circuit Breaker & Component Series | 
                    
                    
                    
                        | 154. VCB Frame | 
                    
                    
                    
                        | 155. PT Handcart | 
                    
                    
                    
                        | 156. Indoor & Outdoor Frame | 
                    
                    
                    
                        | 157. Switchgear Frame | 
                    
                    
                    
                        | 158. VCB Mechanism | 
                    
                    
                    
                        | 159. Parts And Accessories | 
                    
                    
                    
                        | 160. Chassis Truck | 
                    
                    
                    
                        | 161. Guide Rail | 
                    
                    
                    
                        | 162. Interlock | 
                    
                    
                    
                        | 163. Shutter Mechanism | 
                    
                    
                    
                        | 164. Plum Blossom Contact | 
                    
                    
                    
                        | 165. Contact Arm | 
                    
                    
                    
                        | 166. Static Contact | 
                    
                    
                    
                        | 167. Fuseholder & Bushing & Insulation Plug | 
                    
                    
                    
                        | 168. Poles | 
                    
                    
                    
                        | 169. Charged Display | 
                    
                    
                    
                        | 170. Other parts | 
                    
                    
                    
                        | 171. Auxiliary Switch | 
                    
                    
                    
                        | 172. Hydraulic Tools Series | 
                    
                    
                    
                        | 173. Crimping Tool | 
                    
                    
                    
                        | 174. Cable Cutter | 
                    
                    
                    
                        | 175. Cable Stripper | 
                    
                    
                    
                        | 176. Cutting,Bending,Punching Tool | 
                    
                    
                    
                        | 177. Hydraulic Pump | 
                    
                    
                    
                        | 178. Rebar Cutter | 
                    
                    
                    
                        | 179. Pipe Bender | 
                    
                    
                    
                        | 180. Hydraulic Puller | 
                    
                    
                    
                        | 181. Hydraulic Cylinder | 
                    
                    
                    
                        | 182. Pipe Tool | 
                    
                    
                    
                        | 183. Others | 
                    
                    
                    
                        | 184. JGY COPPER CRIMP LUG | 
                    
                    
                    
                        | 185. SC(JGK) COPPER CRIMP LUG | 
                    
                    
                    
                        | 186. COPPER CRIMP LUG SHORT BARREL (TYPE JG) | 
                    
                    
                    
                        | 187. SC(JGB) CABLE CONNECTOR | 
                    
                    
                    
                        | 188. AUS COPPER LUGS(DIN TYPE) | 
                    
                    
                    
                        | 189. DT(G) COPPER COMPRESSION LUGS | 
                    
                    
                    
                        | 190. LONG PALM COPPER CABLE LUG(2 HOLES)-LPCL | 
                    
                    
                    
                        | 191. COOPER CABLE LUG(2 HOLES) | 
                    
                    
                    
                        | 192. COOPER CABLE LUG(2 HOLES) | 
                    
                    
                    
                        | 193. COOPER CABLE LUG(4 HOLES) | 
                    
                    
                    
                        | 194. GTY-1 CABLE CRIMP CONNECTOR TO DIN | 
                    
                    
                    
                        | 195. CAL-1 CABLE BIMETALLIC LUG | 
                    
                    
                    
                        | 196. CAL-2 BIMETALLIC LUG | 
                    
                    
                    
                        | 197. CAO-1 BIMETALLIC LUG | 
                    
                    
                    
                        | 198. DTL-1 CABLE BIMETALLIC LUG | 
                    
                    
                    
                        | 199. MCCB BIMETALLIC LUG | 
                    
                    
                    
                        | 200. SQUARE PLATE BIMETALLIC LUG | 
                    
                    
                    
                        | 201. LONG PLATE BIMETALLIC LUG WITH 2 HOLES | 
                    
                    
                    
                        | 202. LONG PALM BIMETALLIC LUG WITH 2 HOLES | 
                    
                    
                    
                        | 203. BIMETALLIC LUG | 
                    
                    
                    
                        | 204. BIMETALLIC LUG | 
                    
                    
                    
                        | 205. BI-METAL LUG-DLT-G | 
                    
                    
                    
                        | 206. BOLT TYPE BI-METAL LUG | 
                    
                    
                    
                        | 207. GTL BIMETALLIC FRICTION WELDED CONNECTOR | 
                    
                    
                    
                        | 208. DSL BI-METAL STALK CONNECTOR | 
                    
                    
                    
                        | 209. PBL-B PIN TYPE BI-METAL CONNECTOR | 
                    
                    
                    
                        | 210. PBL-A BI-METAL CONNECTOR(PIN TYPE) | 
                    
                    
                    
                        | 211. CAU BI-METAL CRIMP CONNECTOR | 
                    
                    
                    
                        | 212. CAU BI-METAL CRIMP CONNECTOR | 
                    
                    
                    
                        | 213. MECHANICAL CABLE LUG CENTRIC WITH 2 OR 3 SHEAR-OFF-HEAD BOLTS | 
                    
                    
                    
                        | 214. MECHANICAL CONNECTOR 42KV WITH 2 HEXAGON SOCKET SCREWS OR 2 SHEAR-OFF-HEAD BOLTS AND OIL STOP | 
                    
                    
                    
                        | 215. CAPG COPPER AND ALUMINIUM PARALLEL GROOVE CLAMP | 
                    
                    
                    
                        | 216. APG  ALUMINIUM PARALLEL GROOVE CLAMP | 
                    
                    
                    
                        | 217. PRE-INSULATED INJECTION BIMETALLIC LUG | 
                    
                    
                    
                        | 218. PRE-INSULATED INJECTION BIMETALLIC CONNECTOR | 
                    
                    
                    
                        | 219. PRE-INSULATED JUNCTION SLEEVES | 
                    
                    
                    
                        | 220. PRE-INSULATED JUNCTION SLEEVES | 
                    
                    
                    
                        | 221. LT1-3 SOLDERLESS TERMINAL LUGS | 
                    
                    
                    
                        | 222. LS11-1 SOLDERLESS TERMINAL LUGS | 
                    
                    
                    
                        | 223. LS1-1-Z SOLDERLESS TERMINAL LUGS | 
                    
                    
                    
                        | 224. LS1-1-T SOLDERLESS TERMINAL LUGS | 
                    
                    
                    
                        | 225. LH1-2 SOLDERLESS TERMINAL LUGS | 
                    
                    
                    
                        | 226. LF1-T SOLDERLESS TERMINAL LUGS | 
                    
                    
                    
                        | 227. LF1-1Z SOLDERLESS TERMINAL LUGS | 
                    
                    
                    
                        | 228. LF1-1Z SOLDERLESS TERMINAL LUGS | 
                    
                    
                    
                        | 229. LC2-4 SOLDERLESS TERMINAL LUGS | 
                    
                    
                    
                        | 230. LC2-3 SOLDERLESS TERMINAL LUGS | 
                    
                    
                    
                        | 231. LS1-1 SOLDERLESS TERMINAL LUGS | 
                    
                    
                    
                        | 232. LH1-2 SOLDERLESS TERMINAL LUGS | 
                    
                    
                    
                        | 233. NF037(PAE-25B) ACHORING WEDGE CLAMP | 
                    
                    
                    
                        | 234. Nf068( PAE-25A)  ANCHOR CLAMP | 
                    
                    
                    
                        | 235. ADSS TENSION CLAMP | 
                    
                    
                    
                        | 236. OPGW TENSION CLAMP | 
                    
                    
                    
                        | 237. OPGW TENSION CLAMP | 
                    
                    
                    
                        | 238. PAA-50 ACHORING WEDGE CLAMP | 
                    
                    
                    
                        | 239. PAA-235& PAA-35 ANCHORING WEDGE CLAMP | 
                    
                    
                    
                        | 240. JBG ANCHORING WEDGE CLAMPS | 
                    
                    
                    
                        | 241. PAG ANCHOR CLAMP | 
                    
                    
                    
                        | 242. PAG ANCHOR CLAMP | 
                    
                    
                    
                        | 243. PAN SINGLE-CORE ANCHOR CLAMP | 
                    
                    
                    
                        | 244. PAB 2-CORE  ANCHOR CLAMP | 
                    
                    
                    
                        | 245. PA-25 ANCHORING WEDGE CLAMP | 
                    
                    
                    
                        | 246. PA-25B 2 CORE ANCHOR CLAMP | 
                    
                    
                    
                        | 247. PAL ANCHORING WEDGE CLAMPS | 
                    
                    
                    
                        | 248. PAR20 ACHORING WEDGE CLAMP | 
                    
                    
                    
                        | 249. PAR21 ANCHOR CLAMP | 
                    
                    
                    
                        | 250. JBH TENSION CLAMP | 
                    
                    
                    
                        | 251. PAL ANCHORING WEDGE CLAMPS | 
                    
                    
                    
                        | 252. PROFESSIONAL ANCHORING CLAMP FOR FIBER CABLE | 
                    
                    
                    
                        | 253. PAT-95 ANCHORING BRANCH CLAMP | 
                    
                    
                    
                        | 254. CPD HOT LINE CLAMP | 
                    
                    
                    
                        | 255. PAT-50 ANCHORING BRANCH CLAMP | 
                    
                    
                    
                        | 256. PAD-435  ANCHORING BRANCH CLAMP | 
                    
                    
                    
                        | 257. PAT-H 4-CORE COLLECTION TENSION CLAMP | 
                    
                    
                    
                        | 258. NES 4-CORE COLLECTION TENSION CLAMP | 
                    
                    
                    
                        | 259. PAR 4-CORE ANCHORING BRANCH CLAM | 
                    
                    
                    
                        | 260. PAC 2 or 4-CORE ANCHORING BRANCH CLAM | 
                    
                    
                    
                        | 261. BIC SUPSENSION CLAMP | 
                    
                    
                    
                        | 262. SUPENSION CLAMP 95B | 
                    
                    
                    
                        | 263. BIC SUPENSION CLAMP | 
                    
                    
                    
                        | 264. NUPS54 BRACE CLAMP | 
                    
                    
                    
                        | 265. PIC SUPENSION CLAMP | 
                    
                    
                    
                        | 266. E895 SUPPORTING CLAMP FOR NO.8 FIBER CABLE | 
                    
                    
                    
                        | 267. E648 SUPPORTING CLAMP FOR NO.8 FIBER CABLE | 
                    
                    
                    
                        | 268. E768 SUPPORTING CLAMP FOR NO.8 FIBER CABLE | 
                    
                    
                    
                        | 269. 95C BRACE CLAMP | 
                    
                    
                    
                        | 270. 95A BRACE CLAMP | 
                    
                    
                    
                        | 271. WALL FITTING FOR SELF SUPPORT INSULATED WIRE | 
                    
                    
                    
                        | 272. WALL FITTING FOR SELF SUPPORT INSULATED WIRE | 
                    
                    
                    
                        | 273. LM BRACE CLAMP | 
                    
                    
                    
                        | 274. PSPC SUPENSION CLAMP | 
                    
                    
                    
                        | 275. Nf068( PAE-25A) ANCHOR CLAMP | 
                    
                    
                    
                        | 276. PAL ANCHORING WEDGE CLAMPS | 
                    
                    
                    
                        | 277. NF037(PAE-25B) ACHORING WEDGE CLAMP | 
                    
                    
                    
                        | 278. CS-X1 HOOK | 
                    
                    
                    
                        | 279. CAB25 STAINLESS STEEL ANCHOR BRACKET | 
                    
                    
                    
                        | 280. ES-15 SUSPENSION SET | 
                    
                    
                    
                        | 281. ES-14 SUSPENSION SET FOR INSUATED CONDUCTORS | 
                    
                    
                    
                        | 282. SUSPENSION SET FOR INSULATED OVERHEAD CONDUCTORS CS14 TYPE | 
                    
                    
                    
                        | 283. ES BRACKET FOR INSULATED OVERHEAD CONDUCTORS | 
                    
                    
                    
                        | 284. Cs1300 HOOK | 
                    
                    
                    
                        | 285. Cs10 ANCHOR CLAMP BRACKET | 
                    
                    
                    
                        | 286. CS-F1 HOOK | 
                    
                    
                    
                        | 287. CSDY10 ROUND ALUMINIUM BRACKET | 
                    
                    
                    
                        | 288. CSDY10 ROUND ALUMINIUM BRACKET | 
                    
                    
                    
                        | 289. 96B HOOK | 
                    
                    
                    
                        | 290. 96A HOOK | 
                    
                    
                    
                        | 291. Cs1200 HOOK | 
                    
                    
                    
                        | 292. Customized Parts | 
                    
                    
                    
                        | 293. Customized Parts | 
                    
                    
                    
                        | 294. Customized Parts | 
                    
                    
                    
                        | 295. Customized Parts | 
                    
                    
                    
                        | 296. Customized Parts | 
                    
                    
                    
                        | 297. Customized Parts | 
                    
                    
                    
                        | 298. Customized Parts | 
                    
                    
                    
                        | 299. Customized Parts | 
                    
                    
                    
                        | 300. Customized Parts | 
                    
                    
                    
                        | 301. Insulation Piercing Connector(1KV 1Bolt) | 
                    
                    
                    
                        | 302. Insulation Piercing Connector(1KV 2Bolt) | 
                    
                    
                    
                        | 303. Insulation Piercing Connector(TTD/TJF) | 
                    
                    
                    
                        | 304. Insulation Piercing Connector(CT/PGC/PGH) | 
                    
                    
                    
                        | 305. Suspension Clamp (XJ) | 
                    
                    
                    
                        | 306. Plastic Anchor Clamp | 
                    
                    
                    
                        | 307. Metal Anchor Clamp | 
                    
                    
                    
                        | 308. Dead End Clamp(PA) | 
                    
                    
                    
                        | 309. Dead End Clamp(PM/PAZ) | 
                    
                    
                    
                        | 310. Suspension Clamp | 
                    
                    
                    
                        | 311. Suspension Clamp(PS) | 
                    
                    
                    
                        | 312. Suspension Clamp(PT/PL) | 
                    
                    
                    
                        | 313. Suspension Clamp(PF) | 
                    
                    
                    
                        | 314. Anchor Bracket(CR/CA) | 
                    
                    
                    
                        | 315. Anchor Bracket(CS/CA/CT) | 
                    
                    
                    
                        | 316. Tension Clamp | 
                    
                    
                    
                        | 317. COPPERBOND EARTH ROD | 
                    
                    
                    
                        | 318. SOLID COPPER  EARTH ROD | 
                    
                    
                    
                        | 319. STAINLESS STEEL EARTH ROD | 
                    
                    
                    
                        | 320. EARTH ROD ACCESSORIES | 
                    
                    
                    
                        | 321. EARTH ROD COUPLER/COMPRESSION COUPLER | 
                    
                    
                    
                        | 322. ROD TO TAPE CLAMP-(TYPE A) | 
                    
                    
                    
                        | 323. ROD TO TAPE CLAMP-(TYPE A) | 
                    
                    
                    
                        | 324. ROD TO CABLE CLAMP-(TYPE G) | 
                    
                    
                    
                        | 325. SPLIT CONNECTOR CLAMP-(TYPE L) | 
                    
                    
                    
                        | 326. PARELELL GROOVE CLAMP | 
                    
                    
                    
                        | 327. U BOLT ROD CLAMP(TYPE E) | 
                    
                    
                    
                        | 328. U BOLT ROD TO CABLE CLAMP(TYPE GUV) | 
                    
                    
                    
                        | 329. U BOLT PIPE TO CABLE CLAMP(TYPE PUB) | 
                    
                    
                    
                        | 330. U BOLT ROD TO CABLE CLAMP(TYPE KUV) | 
                    
                    
                    
                        | 331. U BOLT ROD TO CABLE CLAMP(TYPE SCE) | 
                    
                    
                    
                        | 332. U BOLT ROD TO CABLE CLAMP(TYPE SCE) | 
                    
                    
                    
                        | 333. WATER MAIN BOND | 
                    
                    
                    
                        | 334. B BOND | 
                    
                    
                    
                        | 335. RWP BOND | 
                    
                    
                    
                        | 336. TOWER EARTH CLAMP (SINGLE & DOUBLE PLATE) | 
                    
                    
                    
                        | 337. CABLE T CLAMP | 
                    
                    
                    
                        | 338. HEAVY DUTY CONDUCTOR SADDLE | 
                    
                    
                    
                        | 339. CABLE TO SQUARE JOINT CLAMP | 
                    
                    
                    
                        | 340. OBLONG TEST CLAMP | 
                    
                    
                    
                        | 341. DC TAPE CLIP | 
                    
                    
                    
                        | 342. CABLE TO SQUARE TAPE CLAMP | 
                    
                    
                    
                        | 343. PLATE TEST CLAMP | 
                    
                    
                    
                        | 344. SCREW DOWN TEST CLAMP | 
                    
                    
                    
                        | 345. TAPE CLIPS | 
                    
                    
                    
                        | 346. COPPER TAPE CLIPS | 
                    
                    
                    
                        | 347. One Hole Clip | 
                    
                    
                    
                        | 348. C CLIP | 
                    
                    
                    
                        | 349. SPLIT BOLT CLAMP | 
                    
                    
                    
                        | 350. Multiple Point | 
                    
                    
                    
                        | 351. TAPER POINTED AIR RODS | 
                    
                    
                    
                        | 352. AIR TERMINAL BASE | 
                    
                    
                    
                        | 353. Disconnecting Link | 
                    
                    
                    
                        | 354. EARTH BAR | 
                    
                    
                    
                        | 355. HARD DRAWN COPPER TAPE | 
                    
                    
                    
                        | 356. HARD DRAWN TINNED COPPER TAPE | 
                    
                    
                    
                        | 357. PVC COVERED COPPER TAPE | 
                    
                    
                    
                        | 358. SOFT DRAWN STRANDED COPPER CABLE(COVERED/TINNED/BARED) | 
                    
                    
                    
                        | 359. PVC COVERED SOLID CIRCULAR COPPER(ALUMINIUM) | 
                    
                    
                    
                        | 360. EXOTHERMIC WELDING | 
                    
                    
                    
                        | 361. THE SELECTOR CHARTS | 
                    
                    
                    
                        | 362. EARTH INSPECTION PIT | 
                    
                    
                    
                        | 363. SOLID COPPER PLATES | 
                    
                    
                    
                        | 364. SOLID COPPER PLATES | 
                    
                    
                    
                        | 365. LATTICE COPPER EARTH MATS | 
                    
                    
                    
                        | 366. CUSTOMIZED PARTS | 
                    
                    
                    
                        | 367. CUSTOMIZED PARTS | 
                    
                    
                    
                        | 368. CUSTOMIZED PARTS | 
                    
                    
                    
                        | 369. CUSTOMIZED PARTS | 
                    
                    
                    
                        | 370. CUSTOMIZED PARTS | 
                    
                    
                    
                        | 371. CUSTOMIZED PARTS | 
                    
                    
                    
                        | 372. CUSTOMIZED PARTS | 
                    
                    
                    
                        | 373. CUSTOMIZED PARTS | 
                    
                    
                    
                        | 374. Making a connection | 
                    
                    
                    
                        | 375. SHBB1 | 
                    
                    
                    
                        | 376. SHBB2 | 
                    
                    
                    
                        | 377. SHBB3 | 
                    
                    
                    
                        | 378. SHBB4 | 
                    
                    
                    
                        | 379. SHBB5 | 
                    
                    
                    
                        | 380. SHBB6 | 
                    
                    
                    
                        | 381. SHBJ1 | 
                    
                    
                    
                        | 382. SHBJ2 | 
                    
                    
                    
                        | 383. SHBC1 | 
                    
                    
                    
                        | 384. SHBC | 
                    
                    
                    
                        | 385. SHCB1 | 
                    
                    
                    
                        | 386. SHCR1 | 
                    
                    
                    
                        | 387. SHCC1 | 
                    
                    
                    
                        | 388. SHCC2 | 
                    
                    
                    
                        | 389. SHCC3 | 
                    
                    
                    
                        | 390. SHCC4 | 
                    
                    
                    
                        | 391. SHCC5 | 
                    
                    
                    
                        | 392. SHCR2 | 
                    
                    
                    
                        | 393. SHCE1 | 
                    
                    
                    
                        | 394. SHCE2 | 
                    
                    
                    
                        | 395. SHCE2 | 
                    
                    
                    
                        | 396. SHCE2 | 
                    
                    
                    
                        | 397. SHEC1 | 
                    
                    
                    
                        | 398. SHCS1 | 
                    
                    
                    
                        | 399. SHCS2 | 
                    
                    
                    
                        | 400. SHCS3 | 
                    
                    
                    
                        | 401. SHCS4 | 
                    
                    
                    
                        | 402. SHCS5 | 
                    
                    
                    
                        | 403. SHCS6 | 
                    
                    
                    
                        | 404. SHCS7 | 
                    
                    
                    
                        | 405. SHCS8 | 
                    
                    
                    
                        | 406. SHCS9 | 
                    
                    
                    
                        | 407. SHRL | 
                    
                    
                    
                        | 408. SHRL5 | 
                    
                    
                    
                        | 409. SHRL1 | 
                    
                    
                    
                        | 410. SHRL3 | 
                    
                    
                    
                        | 411. EXOTHERMIC WELDING MINI Mould | 
                    
                    
                    
                        | 412. Copper Braided Connectors With Ferrules | 
                    
                    
                    
                        | 413. Copper Braided Connectors With Lugs | 
                    
                    
                    
                        | 414. Copper Braided Connectors With Welded Ends | 
                    
                    
                    
                        | 415. Flexible Braided Copper Wires | 
                    
                    
                    
                        | 416. Copper Shielding Wires | 
                    
                    
                    
                        | 417. Copper Braided Mese | 
                    
                    
                    
                        | 418. Copper Stranded Connectors With Ferrules | 
                    
                    
                    
                        | 419. Copper Stranded Connectors With Lugs | 
                    
                    
                    
                        | 420. Flexible Stranded Copper Wires | 
                    
                    
                    
                        | 421. Stranded Copper Wires | 
                    
                    
                    
                        | 422. Insulated Flexible Eopper Stranded Wires | 
                    
                    
                    
                        | 423. Hard Drawn Copper Stranded Wires | 
                    
                    
                    
                        | 424. AC Series F.R.L Three Units | 
                    
                    
                    
                        | 425. AC Series F.R.L Two Units | 
                    
                    
                    
                        | 426. AW Series Fiter & Requlator | 
                    
                    
                    
                        | 427. AF Series Air Filter | 
                    
                    
                    
                        | 428. AR Series Requlator | 
                    
                    
                    
                        | 429. AL Series Oil Lubricator | 
                    
                    
                    
                        | 430. QTYH Series High Pressure Regulator | 
                    
                    
                    
                        | 431. QTY Series Regulator | 
                    
                    
                    
                        | 432. QSL Series Fiter | 
                    
                    
                    
                        | 433. QIU Series Oil Lubricator | 
                    
                    
                    
                        | 434. A/B Series F.R.L Three Units | 
                    
                    
                    
                        | 435. A/B Series F.R.L Two Units | 
                    
                    
                    
                        | 436. A/B Series Filter & Regulator | 
                    
                    
                    
                        | 437. A/B Series Filter | 
                    
                    
                    
                        | 438. A/B Series Regulator | 
                    
                    
                    
                        | 439. A/B Series Oil Lubricator | 
                    
                    
                    
                        | 440. GC Series F.R.L Three Units | 
                    
                    
                    
                        | 441. GFC Series F.R.L Two Units | 
                    
                    
                    
                        | 442. GFR Series Fiter & Regulator | 
                    
                    
                    
                        | 443. GF Series Filter | 
                    
                    
                    
                        | 444. GR Series Regulator | 
                    
                    
                    
                        | 445. GL Series Lubricator | 
                    
                    
                    
                        | 446. FOU Series F.R.L Three Units | 
                    
                    
                    
                        | 447. FRC Series F.R.L Two Units | 
                    
                    
                    
                        | 448. LFR Series Filter & Regulator | 
                    
                    
                    
                        | 449. LF Series Filter | 
                    
                    
                    
                        | 450. LR Series Regulator | 
                    
                    
                    
                        | 451. LOE Series Oil Lubricator | 
                    
                    
                    
                        | 452. URLF Series F.R.L Three Units | 
                    
                    
                    
                        | 453. UFR/L Series F.R.L Two Units | 
                    
                    
                    
                        | 454. UFR Series Filter & Regulator | 
                    
                    
                    
                        | 455. UF Series Filter | 
                    
                    
                    
                        | 456. UR Series Regulator | 
                    
                    
                    
                        | 457. UL Series Oil Lubricator | 
                    
                    
                    
                        | 458. C Series F.R.L Three Units | 
                    
                    
                    
                        | 459. C Series F.R.L Two Units | 
                    
                    
                    
                        | 460. W Series Filter Regulator | 
                    
                    
                    
                        | 461. F Series Filter | 
                    
                    
                    
                        | 462. R Series Regulator | 
                    
                    
                    
                        | 463. L Series Oil Lubricator | 
                    
                    
                    
                        | 464. 39 Series F.R.L Three Units | 
                    
                    
                    
                        | 465. 39 Series F.R.L Two Units | 
                    
                    
                    
                        | 466. 39 Series Filter & Regulator | 
                    
                    
                    
                        | 467. 39 Series Filter | 
                    
                    
                    
                        | 468. 39 Series Regulator | 
                    
                    
                    
                        | 469. 39 Series Oil Lubricator | 
                    
                    
                    
                        | 470. SFC Series F.R.L Two Units | 
                    
                    
                    
                        | 471. SFR Series Filter & Regulator | 
                    
                    
                    
                        | 472. SL Series Oil Lubricator | 
                    
                    
                    
                        | 473. QFLH Series High Pressure Filter | 
                    
                    
                    
                        | 474. QFRH Series High Pressure Filter & Regulator | 
                    
                    
                    
                        | 475. AD Series Auto Drainer | 
                    
                    
                    
                        | 476. AMD Series Micro Mist Separator/AMG Series Water Separator | 
                    
                    
                    
                        | 477. VHS Series Pressure Relief Valve | 
                    
                    
                    
                        | 478. IR Series Precision Regulator | 
                    
                    
                    
                        | 479. Pressure Gauge | 
                    
                    
                    
                        | 480. VP Series Solenoid Valve | 
                    
                    
                    
                        | 481. 2P/2 V025/3V1 Series Solenoid Valve | 
                    
                    
                    
                        | 482. 3V Series Solenoid Valve | 
                    
                    
                    
                        | 483. 4V Series Solenoid Valve | 
                    
                    
                    
                        | 484. 4M Series Solenoid Valve | 
                    
                    
                    
                        | 485. MVSC Series Solenoid Valve | 
                    
                    
                    
                        | 486. 263/802/2630 Series Solenoid Valve | 
                    
                    
                    
                        | 487. F5214 Series Solenoid Valve(Tigher Valve) | 
                    
                    
                    
                        | 488. VF Series Solenoid Valve | 
                    
                    
                    
                        | 489. SY Series Solenoid Valve | 
                    
                    
                    
                        | 490. SYA Series Air Control Valve | 
                    
                    
                    
                        | 491. Q22HD Series Air Control Valve | 
                    
                    
                    
                        | 492. VT307/VX2120 Series Solenoid Valve | 
                    
                    
                    
                        | 493. VTA301/NTA315 Series Air Control Valve | 
                    
                    
                    
                        | 494. 3A Series Air Control Valve | 
                    
                    
                    
                        | 495. 4A Series Air Control Valve | 
                    
                    
                    
                        | 496. JM Series Mechanical Valve | 
                    
                    
                    
                        | 497. JMJ Series Mechanical Valve | 
                    
                    
                    
                        | 498. M3 Series Mechanical Valve | 
                    
                    
                    
                        | 499. M5 Series Mechanical Valve | 
                    
                    
                    
                        | 500. MV Series Mechanical Valve | 
                    
                    
                    
                        | 501. MOV Series Mechanical Valve | 
                    
                    
                    
                        | 502. S3-210 Series Mechanical Valve | 
                    
                    
                    
                        | 503. S3 Series Mechanical Valve | 
                    
                    
                    
                        | 504. CM3 Series Mechanical Valve | 
                    
                    
                    
                        | 505. VM130、VM131 Series Mechanical Valve | 
                    
                    
                    
                        | 506. VM230 Series Mechanical Valve | 
                    
                    
                    
                        | 507. 3H/4H Series Hand Draw Valve | 
                    
                    
                    
                        | 508. 3L/4L Series Hand Draw Valve | 
                    
                    
                    
                        | 509. JM Series Hand Draw Valve | 
                    
                    
                    
                        | 510. SH Series Hand Draw Valve | 
                    
                    
                    
                        | 511. SR Series Hand Draw Valve | 
                    
                    
                    
                        | 512. 4HV Series Hand Rotary Valve | 
                    
                    
                    
                        | 513. HV Series Hand Rotary Valve | 
                    
                    
                    
                        | 514. VH Series Hand Rotary Valve | 
                    
                    
                    
                        | 515. 3F Series Foot Valve | 
                    
                    
                    
                        | 516. 4F Series Foot Valve | 
                    
                    
                    
                        | 517. FV Series Foot Valve | 
                    
                    
                    
                        | 518. ST Series Foot Valve | 
                    
                    
                    
                        | 519. K Series Foot Valve | 
                    
                    
                    
                        | 520. CV Series Check Valve | 
                    
                    
                    
                        | 521. LCV Series Check Valve | 
                    
                    
                    
                        | 522. ST Series Shuttle Valve | 
                    
                    
                    
                        | 523. KV Series Shuttle Valve | 
                    
                    
                    
                        | 524. KKP Series Shuttle Valve | 
                    
                    
                    
                        | 525. QE Series Quick Exhaust Valve | 
                    
                    
                    
                        | 526. BQE/SEU Series Quick Exhaust Valve | 
                    
                    
                    
                        | 527. KLA Series One Way Throttle Valve | 
                    
                    
                    
                        | 528. ASC Series Speed Control Valve | 
                    
                    
                    
                        | 529. RE Series Speed Control Valve | 
                    
                    
                    
                        | 530. ASV200 Series Stainless Steel Angle Seat Valve | 
                    
                    
                    
                        | 531. HFS Series Control Valve | 
                    
                    
                    
                        | 532. PS Series Pressure Control Switch | 
                    
                    
                    
                        | 533. RNS Pressure Control Switch | 
                    
                    
                    
                        | 534. CBP Series Single Pressure Control Switch | 
                    
                    
                    
                        | 535. CBP Series Double Pressure Control Switch | 
                    
                    
                    
                        | 536. A Series Air Control Valve | 
                    
                    
                    
                        | 537. 2W Series Solenoid Valve | 
                    
                    
                    
                        | 538. 2WS Series Water Proof Solenoid Valve | 
                    
                    
                    
                        | 539. 2WA Series Solenoid Valve | 
                    
                    
                    
                        | 540. 2WK Series Solenoid Valve | 
                    
                    
                    
                        | 541. 2WG Series Solenoid Valve | 
                    
                    
                    
                        | 542. PU220 Series Solenoid Valve | 
                    
                    
                    
                        | 543. PU225 Series Solenoid Valve | 
                    
                    
                    
                        | 544. VX Series Solenoid Valve | 
                    
                    
                    
                        | 545. 2Q Series Valves | 
                    
                    
                    
                        | 546. 2WB Series Solenoid Valve | 
                    
                    
                    
                        | 547. 2WBK Series Solenoid Valve | 
                    
                    
                    
                        | 548. 2WBF Seies Solenoid Valve | 
                    
                    
                    
                        | 549. 2L Seires Solenoid Valve | 
                    
                    
                    
                        | 550. 2S Series Solenoid Valve | 
                    
                    
                    
                        | 551. K Series Solenoid Valve | 
                    
                    
                    
                        | 552. BV Series Safety Valve | 
                    
                    
                    
                        | 553. SCG Series Solenoid Valve | 
                    
                    
                    
                        | 554. Q22/Q23 Seires Solenoid Valve | 
                    
                    
                    
                        | 555. OPT-A/B Electronic Drain Valve | 
                    
                    
                    
                        | 556. SMF Series Pulse Valve | 
                    
                    
                    
                        | 557. SMF Series Pulse Valve | 
                    
                    
                    
                        | 558. SMF-Z Series Pipe Connected Type Pulse Vave | 
                    
                    
                    
                        | 559. 2VT Series Solenoid Valve | 
                    
                    
                    
                        | 560. 2WF/FB2E/DC231 Series Solenoid Valve | 
                    
                    
                    
                        | 561. HL/SHL Series Knob Switch Valve | 
                    
                    
                    
                        | 562. HSV Series Hand Slide Valve | 
                    
                    
                    
                        | 563. 6213 Series Solenoid Valve | 
                    
                    
                    
                        | 564. 5404 High Pressure Solenoid Valve | 
                    
                    
                    
                        | 565. 0927 Series Solenoid Valve | 
                    
                    
                    
                        | 566. R Series Vibrator | 
                    
                    
                    
                        | 567. K Series Vibrator | 
                    
                    
                    
                        | 568. GT Series Vibrator | 
                    
                    
                    
                        | 569. TK-10 Pressure ContrOiler | 
                    
                    
                    
                        | 570. ZSE Pressure Control Switch | 
                    
                    
                    
                        | 571. PIC-20X Pulse Vale ContrOiler | 
                    
                    
                    
                        | 572. SK Series Air Hammer | 
                    
                    
                    
                        | 573. V/MVSC Series Coil | 
                    
                    
                    
                        | 574. DF Series Coil | 
                    
                    
                    
                        | 575. 2W/2S Series Coil | 
                    
                    
                    
                        | 576. Pulse Valve Diaphragm | 
                    
                    
                    
                        | 577. QS5Y Series Manifold | 
                    
                    
                    
                        | 578. 3V Series Manifold | 
                    
                    
                    
                        | 579. 4V,4A Series Manifold | 
                    
                    
                    
                        | 580. Other Valves | 
                    
                    
                    
                        | 581. EV Series Vacuum Ejector | 
                    
                    
                    
                        | 582. ZFC Series Vacuum Ejector | 
                    
                    
                    
                        | 583. ZH Series Vacuum Ejector | 
                    
                    
                    
                        | 584. ZH Series Vacuum Ejector | 
                    
                    
                    
                        | 585. ZH Series Vacuum Ejector | 
                    
                    
                    
                        | 586. ZH Series Vacuum Ejector | 
                    
                    
                    
                        | 587. ZU Series Vacuum Ejector | 
                    
                    
                    
                        | 588. ZP Series Vacuum Pad | 
                    
                    
                    
                        | 589. ZPT Series Vertical Vacuum Entry With Buffer Vacuum Pad | 
                    
                    
                    
                        | 590. ZPR Series Lateral Vacuum Entry With Buffer Vacuum Pad | 
                    
                    
                    
                        | 591. DSBC Series Standard Cylinder | 
                    
                    
                    
                        | 592. DSBG Series Standard Cylinder | 
                    
                    
                    
                        | 593. DNC Series Standard Cylinder | 
                    
                    
                    
                        | 594. DNG Series Standard Cylinder | 
                    
                    
                    
                        | 595. C95/C96 Series Standard Cyinder | 
                    
                    
                    
                        | 596. CA2 Series Standard Cylinder | 
                    
                    
                    
                        | 597. CS1/CS2 Series Standard Cylinder | 
                    
                    
                    
                        | 598. CP95 Series Standard Cylinder | 
                    
                    
                    
                        | 599. MB Series Standard Cylinder | 
                    
                    
                    
                        | 600. MB1 Series Standard Cylinder | 
                    
                    
                    
                        | 601. SE Series Standard Cylinder | 
                    
                    
                    
                        | 602. SI Series Standard Cylinder | 
                    
                    
                    
                        | 603. JSI Series Standard Cylinder | 
                    
                    
                    
                        | 604. SG/SGC Series Standard Cylinder | 
                    
                    
                    
                        | 605. SU Series Standard Cylinder | 
                    
                    
                    
                        | 606. SC Series Standard Cylinder | 
                    
                    
                    
                        | 607. QGA,QGB Series Standard Cylinder | 
                    
                    
                    
                        | 608. DSNU Series Slim Cylinder | 
                    
                    
                    
                        | 609. C85 Series Stainless Steel Mini Cylinder | 
                    
                    
                    
                        | 610. CM2B Series Slim Cylinder | 
                    
                    
                    
                        | 611. CJ1 Series Mini Cylinder | 
                    
                    
                    
                        | 612. CJ2B Series Stainless Steel Mini Cylinder | 
                    
                    
                    
                        | 613. CG1 Series Aluminum Alloy Light-Duty Cylinder | 
                    
                    
                    
                        | 614. CJP Series Slim Cylinder(Single Acting) | 
                    
                    
                    
                        | 615. CJP2 Series Mini Cylinder(Double Acting) | 
                    
                    
                    
                        | 616. PB/PBR Series Pen Shape Cylinder | 
                    
                    
                    
                        | 617. MA Series Slim Cylinder | 
                    
                    
                    
                        | 618. MG Series Slim Cylinder | 
                    
                    
                    
                        | 619. MI Series Slim Cylinder | 
                    
                    
                    
                        | 620. MAL Series Slim Cylinder | 
                    
                    
                    
                        | 621. DA Series Stainless Steel Mini Cylinder | 
                    
                    
                    
                        | 622. AND/AEN Series Compact Cylinder | 
                    
                    
                    
                        | 623. ADVC/AEVC Series Compact Cylinder | 
                    
                    
                    
                        | 624. ADVU Series Compact Cylinder | 
                    
                    
                    
                        | 625. DMM Series Compact Free lnstalation Cyinder | 
                    
                    
                    
                        | 626. CQSB Series Compact Cylinder | 
                    
                    
                    
                        | 627. CQ2B Series Compact Cyinder | 
                    
                    
                    
                        | 628. CQMB Series Compact Cyinder(Guite Rod Type) | 
                    
                    
                    
                        | 629. RQ Series Compact Cylinder | 
                    
                    
                    
                        | 630. CU Series Free Installation Cylinder | 
                    
                    
                    
                        | 631. CUJB Series Small Free Installation Cylinder | 
                    
                    
                    
                        | 632. ZCUK Series Vacum Free lnstallation Cylinder | 
                    
                    
                    
                        | 633. BDA Series Free Installation Cylinder | 
                    
                    
                    
                        | 634. MB Series Free Installation Cylinder | 
                    
                    
                    
                        | 635. ACQ/TACQ Series Compact Cylinder | 
                    
                    
                    
                        | 636. ACP Series Compact Cylinder | 
                    
                    
                    
                        | 637. SDA Series Compact Cylinder | 
                    
                    
                    
                        | 638. SSD2 Serles Compact Cylinder | 
                    
                    
                    
                        | 639. FENG-GF/FENG-KF Series Guiding Device | 
                    
                    
                    
                        | 640. DPZ Series Double Piston Rods Cylinder | 
                    
                    
                    
                        | 641. CXW Series Double Piston Rods Cylinder | 
                    
                    
                    
                        | 642. DFM Series Guide Rod Cylinder | 
                    
                    
                    
                        | 643. CXS Series Dual Cylinder | 
                    
                    
                    
                        | 644. CXSJ Series Double Piston Rods Cylinder | 
                    
                    
                    
                        | 645. TD Series Double Piston Rods Cylinder | 
                    
                    
                    
                        | 646. TB Series Thin Type Guide Rod Cylinder | 
                    
                    
                    
                        | 647. MGP Series Duide Cylinder | 
                    
                    
                    
                        | 648. MGJ Series Micro Duide Cylinder | 
                    
                    
                    
                        | 649. TCM/TCL Series Duide Cylinder | 
                    
                    
                    
                        | 650. TN/TR Series Double Piston Rods Cylinder | 
                    
                    
                    
                        | 651. STM Series Double Piston Rods Cylinder | 
                    
                    
                    
                        | 652. MGC Series Duide Cylinder | 
                    
                    
                    
                        | 653. MGG Series Duide Cylinder | 
                    
                    
                    
                        | 654. MY1 Series Mechanical Type Rodless Cylinder | 
                    
                    
                    
                        | 655. CY3B/CY3R Series Rodless Cylinder | 
                    
                    
                    
                        | 656. CY1S Series Magnetic coupled Rodless Cylinder | 
                    
                    
                    
                        | 657. CY1L Series Magnetic Coupled Rodless Cylinder | 
                    
                    
                    
                        | 658. RMS Series Magnetic Coupled Rodless Cylinder | 
                    
                    
                    
                        | 659. RMT/RMTL Series Magnetic Coupled Rodless Cylinder | 
                    
                    
                    
                        | 660. OST/OSP Series Parker Type Mech.Rodless Cylinder | 
                    
                    
                    
                        | 661. MHL2 Series Air Gripper | 
                    
                    
                    
                        | 662. MHF2 Series Air Gripper | 
                    
                    
                    
                        | 663. MHC2 Series Air Gripper | 
                    
                    
                    
                        | 664. MHT2 Serles Air Gripper | 
                    
                    
                    
                        | 665. MHY2 Series Air Gripper | 
                    
                    
                    
                        | 666. MIW/MIS Series Air Gripper | 
                    
                    
                    
                        | 667. MHW2 Series Air Gripper | 
                    
                    
                    
                        | 668. MHZ2 Series Air Gripper | 
                    
                    
                    
                        | 669. MHZL2 Series Air Gripper | 
                    
                    
                    
                        | 670. HFP Series Air Gripper | 
                    
                    
                    
                        | 671. HFR Series Air Gripper | 
                    
                    
                    
                        | 672. HFY Series Air Gripper | 
                    
                    
                    
                        | 673. HFZ Series Air Gripper | 
                    
                    
                    
                        | 674. HDM/HDP Series Angle Type Mechanical.Claw | 
                    
                    
                    
                        | 675. HDS Series Angular Gripper | 
                    
                    
                    
                        | 676. TEJ Series Pneumatic Clamp | 
                    
                    
                    
                        | 677. MHS Sliding Rail Cylinder | 
                    
                    
                    
                        | 678. STMB Series Double Joint Cylinder | 
                    
                    
                    
                        | 679. MXS Series Slide Cylinder | 
                    
                    
                    
                        | 680. MXH Series Slide Cylider | 
                    
                    
                    
                        | 681. MXQ Series Slide Cylider | 
                    
                    
                    
                        | 682. SCR Series Cornered Cylider | 
                    
                    
                    
                        | 683. MK/MK2 Series Rotary Cylinder | 
                    
                    
                    
                        | 684. CK1 Series Clamp Cylinder | 
                    
                    
                    
                        | 685. CRB1 Senes Large Vane Swing Cylinder | 
                    
                    
                    
                        | 686. CRB2BW Series Vane Swing Cylinder | 
                    
                    
                    
                        | 687. CRBU2W Series Vane Swing Cylinder | 
                    
                    
                    
                        | 688. CRA1 Series Rotary Cylinder | 
                    
                    
                    
                        | 689. MSQ Series Rotary Cylinder | 
                    
                    
                    
                        | 690. CRQ2 Series Rotary Cylinder | 
                    
                    
                    
                        | 691. MRHQ Series Rotary Cylinder | 
                    
                    
                    
                        | 692. MSZ Series Rotary Cylinder | 
                    
                    
                    
                        | 693. ACK Series Rotary Cylinder | 
                    
                    
                    
                        | 694. ASC Series Full Thread Corner Cylinder | 
                    
                    
                    
                        | 695. SRC Series Rotary Cylinder | 
                    
                    
                    
                        | 696. JGL Series Lever Clamping Cylinder | 
                    
                    
                    
                        | 697. TWQ Series Stop Cylinder | 
                    
                    
                    
                        | 698. TWH Series Stop Cylinder | 
                    
                    
                    
                        | 699. TWG Series Stop Cylinder | 
                    
                    
                    
                        | 700. RTP Series Rotary Cylinder | 
                    
                    
                    
                        | 701. RTH Series Rotary Cylinder | 
                    
                    
                    
                        | 702. ZH Series Gas-Liquid Converter | 
                    
                    
                    
                        | 703. QGZN Series Standard Cylinder | 
                    
                    
                    
                        | 704. PM Series Strike Knife Cylinder | 
                    
                    
                    
                        | 705. MPT/MPTF/MPTS Senes Boosting Cyinder | 
                    
                    
                    
                        | 706. MPTG/MPTD Series Boosting Cylinder | 
                    
                    
                    
                        | 707. ZQ Series Cable Track Towing Chain | 
                    
                    
                    
                        | 708. HGH Series Linear Guides | 
                    
                    
                    
                        | 709. HT Single Column Air Press | 
                    
                    
                    
                        | 710. HT-1 Double Column Air Press | 
                    
                    
                    
                        | 711. HT Quadruple Column High Accuracy Air Press | 
                    
                    
                    
                        | 712. HT Triple Column High Accuracy Air Press | 
                    
                    
                    
                        | 713. HT-C Column Air Press | 
                    
                    
                    
                        | 714. HT Quadruple Column High Accuracy Boosting Press | 
                    
                    
                    
                        | 715. HT Triple Column High Accuracy Boosting Press | 
                    
                    
                    
                        | 716. HT-C Column Air Press | 
                    
                    
                    
                        | 717. HT Double Column Air Press | 
                    
                    
                    
                        | 718. SC Series Cylinder Accessories | 
                    
                    
                    
                        | 719. SI/SAI Series Cylinder Accessories | 
                    
                    
                    
                        | 720. DSBC/SDBG/DNC Series Cylinder Accessories | 
                    
                    
                    
                        | 721. MBB Series Cylinder Accessories | 
                    
                    
                    
                        | 722. CA2BN Series Cylinder Accessories | 
                    
                    
                    
                        | 723. CS2BN/CSIBN Series Cylinder Accessories | 
                    
                    
                    
                        | 724. CG1BN/MG Series Cylinder Accessories | 
                    
                    
                    
                        | 725. DSNU/C85/MI Series Cylinder Accessories | 
                    
                    
                    
                        | 726. CQ2B/ACQ/SDA Series Cylinder Accessories | 
                    
                    
                    
                        | 727. IADVU/ACP Series Cylinder Accessories | 
                    
                    
                    
                        | 728. CDJ2B/CDM2B/MF/PB Series Cylinder Accessories | 
                    
                    
                    
                        | 729. MA/MAL Series Cylinder Accessories | 
                    
                    
                    
                        | 730. MOB,HOB Series Cylinder Accessories | 
                    
                    
                    
                        | 731. FJ Series Floating Joint | 
                    
                    
                    
                        | 732. SI Series Fish Eye Joint | 
                    
                    
                    
                        | 733. CS1 Series Magnetic Switch | 
                    
                    
                    
                        | 734. DS1 Series Magnetic Switch | 
                    
                    
                    
                        | 735. D Series Magnetic Switch | 
                    
                    
                    
                        | 736. Magnetic Switch Mounting Bracket | 
                    
                    
                    
                        | 737. DNC Cylinder Kits | 
                    
                    
                    
                        | 738. SI Cylinder Kits | 
                    
                    
                    
                        | 739. SC Cylinder Kits | 
                    
                    
                    
                        | 740. DNC Square Aluminum Tube | 
                    
                    
                    
                        | 741. SI Cylinder Aluminum Tube | 
                    
                    
                    
                        | 742. Piston Rod | 
                    
                    
                    
                        | 743. Mini One Touch Fiting | 
                    
                    
                    
                        | 744. Iron One Touch Fiting | 
                    
                    
                    
                        | 745. Plastic One Touch Fitting | 
                    
                    
                    
                        | 746. SMC Type One Touch Fitting | 
                    
                    
                    
                        | 747. Rotary One Touch Fiting | 
                    
                    
                    
                        | 748. Stop One Touch Fiting | 
                    
                    
                    
                        | 749. Ferrule Fitting | 
                    
                    
                    
                        | 750. Fast Twist Fitting | 
                    
                    
                    
                        | 751. C Type Quick Couplers | 
                    
                    
                    
                        | 752. Stainless Steel One Touch Fiting | 
                    
                    
                    
                        | 753. Brass One Touch Fitting/Silencers | 
                    
                    
                    
                        | 754. Other Series Fiting | 
                    
                    
                    
                        | 755. Air Gun | 
                    
                    
                    
                        | 756. Tube Cutter | 
                    
                    
                    
                        | 757. Lubrication Oil | 
                    
                    
                    
                        | 758. PU Series PU Tube | 
                    
                    
                    
                        | 759. PUB Series PU Braided Tube | 
                    
                    
                    
                        | 760. CLW Series Coil PU Tube | 
                    
                    
                    
                        | 761. PE Tube | 
                    
                    
                    
                        | 762. PA6,PA9,PA11,PA12 Nylon Tube | 
                    
                    
                    
                        | 763. PU Series PU Tube | 
                    
                    
                    
                        | 764. ST Series Silicone Tube | 
                    
                    
                    
                        | 765. FT Series Flexible Tube | 
                    
                    
                    
                        | 766. OEL/OELS Series Cooling Tube | 
                    
                    
                    
                        | 767. AP Series Aluminum Tube | 
                    
                    
                    
                        | 768. HR Series Shock Absorbers | 
                    
                    
                    
                        | 769. AC Series Shock Absorbers | 
                    
                    
                    
                        | 770. FC Series Shock Absorbers | 
                    
                    
                    
                        | 771. MOB Series Hydraulic Cylinder | 
                    
                    
                    
                        | 772. HOB Series Hydraulic Cylinder | 
                    
                    
                    
                        | 773. G02 Series Hydraulic Solenoid Valve | 
                    
                    
                    
                        | 774. G03 Series Hydraulic Solenoid Valve | 
                    
                    
                    
                        | 775. KQ2H Straight connector | 
                    
                    
                    
                        | 776. KQ2H Straight connection(G thread) | 
                    
                    
                    
                        | 777. KQ2H Stainless steel straight connector | 
                    
                    
                    
                        | 778. KQ2S Straight connector with hexagonal socket | 
                    
                    
                    
                        | 779. KQ2F Internal thread straight connector | 
                    
                    
                    
                        | 780. KQ2E Panel mount female straight fitting | 
                    
                    
                    
                        | 781. KQ2E Panel mount pass-through connector | 
                    
                    
                    
                        | 782. KQ2LE Panel mount elbow | 
                    
                    
                    
                        | 783. KQ2L Intubation elbow | 
                    
                    
                    
                        | 784. KQ2L Elbow | 
                    
                    
                    
                        | 785. KQ2L Elbow(G thread) | 
                    
                    
                    
                        | 786. KQ2L Stainless steel elbow | 
                    
                    
                    
                        | 787. KQ2W Extended elbow | 
                    
                    
                    
                        | 788. KQ2LF Internal thread elbow | 
                    
                    
                    
                        | 789. KQ2V Universal elbow | 
                    
                    
                    
                        | 790. KQ2Z Double tube universal elbow | 
                    
                    
                    
                        | 791. KQ2LU Double pipe elbow | 
                    
                    
                    
                        | 792. KQ2D Two pipe vertical joint | 
                    
                    
                    
                        | 793. KQ2U Y-joint | 
                    
                    
                    
                        | 794. KQ2T Double tube T-joint | 
                    
                    
                    
                        | 795. KQ2Y Auxiliary T-joint | 
                    
                    
                    
                        | 796. KQ2UD Four-tube Y-joint | 
                    
                    
                    
                        | 797. KQ2XD Intubation four-tube Y-shaped nozzle | 
                    
                    
                    
                        | 798. KQ2U Intubation Y-shaped nozzle | 
                    
                    
                    
                        | 799. KQ2X Intubation reducing Y-shaped pipe | 
                    
                    
                    
                        | 800. KQ2VF Universal joint with internal and external threads | 
                    
                    
                    
                        | 801. KQ2ZF Double tube universal joint with internal and external threads | 
                    
                    
                    
                        | 802. KQ2VS Universal elbow with hexagonal socket | 
                    
                    
                    
                        | 803. KQ2ZS Double tube universal joint with hexagonal socket | 
                    
                    
                    
                        | 804. KQ2VD Two single tube universal elbows | 
                    
                    
                    
                        | 805. KQ2VT Three single tube universal elbows | 
                    
                    
                    
                        | 806. KQ2ZD Two double-tube universal elbows | 
                    
                    
                    
                        | 807. KQ2ZT Three double-tube universal elbows | 
                    
                    
                    
                        | 808. KQ2VD Double universal thread (internal thread) elbow | 
                    
                    
                    
                        | 809. KQSH Pass-through takeover | 
                    
                    
                    
                        | 810. KQ2L Bend pipe | 
                    
                    
                    
                        | 811. KQ2U Y-shaped takeover | 
                    
                    
                    
                        | 812. KQ2T T-shaped takeover | 
                    
                    
                    
                        | 813. KQ2LU Double tube elbow | 
                    
                    
                    
                        | 814. KQ2D Two-pipe vertical takeover | 
                    
                    
                    
                        | 815. KQ2UD Reducing diameter four-tube Y-shaped connecting pipe | 
                    
                    
                    
                        | 816. KQ2TW Cruciform takeover | 
                    
                    
                    
                        | 817. KQ2TX Reducing cross-shaped pipe | 
                    
                    
                    
                        | 818. KQ2TY Reducing cross-shaped pipe | 
                    
                    
                    
                        | 819. KQ2R Intubation reducing diameter nozzle | 
                    
                    
                    
                        | 820. KQ2C Pipe cap | 
                    
                    
                    
                        | 821. KQ2P Pulg | 
                    
                    
                    
                        | 822. AS Push lock type elbow type speed control valve | 
                    
                    
                    
                        | 823. AS Push lock type elbow type speed control valve | 
                    
                    
                    
                        | 824. AFG Stainless steel push lock elbow type speed control valve | 
                    
                    
                    
                        | 825. AFG Stainless steel push lock elbow type speed control valve | 
                    
                    
                    
                        | 826. AS Elbow type speed control valve | 
                    
                    
                    
                        | 827. AS Elbow type speed control valve | 
                    
                    
                    
                        | 828. AS Push lock type universal speed control valve | 
                    
                    
                    
                        | 829. AS Push lock type universal speed control valve | 
                    
                    
                    
                        | 830. AS Push lock type straight-through speed control valve | 
                    
                    
                    
                        | 831. AFG Stanless steel push lock type straight-though speed control valve | 
                    
                    
                    
                        | 832. AS Straight-through speed control valve | 
                    
                    
                    
                        | 833. AS Straight-through/panel-mounted speed control valve | 
                    
                    
                    
                        | 834. AFS Elbow type speed control valve with scale | 
                    
                    
                    
                        | 835. AFS Elbow type speed control valve with scale | 
                    
                    
                    
                        | 836. AFS Scaled straight-through speed control valve | 
                    
                    
                    
                        | 837. ASV Quick exhaust valve with throttle silencer model designation | 
                    
                    
                    
                        | 838. ASN2 series Exhaust throttle valve with silencer model
designation instructions | 
                    
                    
                    
                        | 839. EV Vacuum generator model description | 
                    
                    
                    
                        | 840. ZH Box type (quick connector) | 
                    
                    
                    
                        | 841. ZH Box type(quick connector/thread) | 
                    
                    
                    
                        | 842. ZH Box type (quick connector) | 
                    
                    
                    
                        | 843. ZH Box type(quick connector/thread) | 
                    
                    
                    
                        | 844. ZH Direct piping type(quick connector/thread) | 
                    
                    
                    
                        | 845. ZH Direct piping type(thread) | 
                    
                    
                    
                        | 846. ZU Straight-through vacuum generator model description | 
                    
                    
                    
                        | 847. VM Vacuum generator model description | 
                    
                    
                    
                        | 848. ZFC Straight-through filter model description | 
                    
                    
                    
                        | 849. ZFC Small vacuum filter model description | 
                    
                    
                    
                        | 850. KSH Straight connector (standard type) | 
                    
                    
                    
                        | 851. KXH Straight connector (high speed type) | 
                    
                    
                    
                        | 852. KXL Elbow (high speed type) | 
                    
                    
                    
                        | 853. KXL Elbow (high speed type) | 
                    
                    
                    
                        | 854. VHK 1(P),2(A)-Quick connector | 
                    
                    
                    
                        | 855. VHK 1(P)-External thread,2(A)-Quick connector | 
                    
                    
                    
                        | 856. VHK 1(P),2(A)-External thread | 
                    
                    
                    
                        | 857. VHK 1(P)-Quick connector,2(A)-External thread | 
                    
                    
                    
                        | 858. KJH Straight connector | 
                    
                    
                    
                        | 859. KJS Straight connector with hexagon socket | 
                    
                    
                    
                        | 860. KJF Female thread straight connector | 
                    
                    
                    
                        | 861. KJL Elbow | 
                    
                    
                    
                        | 862. KJT Double tube T-type joint | 
                    
                    
                    
                        | 863. KJY Auxiliary T-type joint | 
                    
                    
                    
                        | 864. KJU Y-joint | 
                    
                    
                    
                        | 865. KJW Extended elbow | 
                    
                    
                    
                        | 866. KJE Panel mount pass-through joint | 
                    
                    
                    
                        | 867. KJH Straight takeover | 
                    
                    
                    
                        | 868. KJT T-shaped connector | 
                    
                    
                    
                        | 869. KJL Elbow | 
                    
                    
                    
                        | 870. KJU Y-shaped take-up | 
                    
                    
                    
                        | 871. KCH Straight connector | 
                    
                    
                    
                        | 872. KCL Elbow | 
                    
                    
                    
                        | 873. KCJ Straight-through cannula with one-way valve | 
                    
                    
                    
                        | 874. KCE Panel Mount Female Straight Fitting | 
                    
                    
                    
                        | 875. KCE Panel mount pass-through connector | 
                    
                    
                    
                        | 876. KCH Straight-through takeover | 
                    
                    
                    
                        | 877. AKH Straight connector type check valve | 
                    
                    
                    
                        | 878. AKB Sleeve type check valve | 
                    
                    
                    
                        | 879. AKH Straight through pipe type check valve | 
                    
                    
                    
                        | 880. BVU Union straight connector | 
                    
                    
                    
                        | 881. BVG Reducing union straight connector | 
                    
                    
                    
                        | 882. BVLU Union elbow | 
                    
                    
                    
                        | 883. BVLG Reducing union elbow | 
                    
                    
                    
                        | 884. BVLC Elbow A | 
                    
                    
                    
                        | 885. BVLC Elbow B | 
                    
                    
                    
                        | 886. BVC Straight connector | 
                    
                    
                    
                        | 887. BC Direct | 
                    
                    
                    
                        | 888. BCF Female thread straight | 
                    
                    
                    
                        | 889. BL Elbow A | 
                    
                    
                    
                        | 890. BVCL Elbow B | 
                    
                    
                    
                        | 891. BM Panel type union pipe straight through | 
                    
                    
                    
                        | 892. BLM Panel union elbow | 
                    
                    
                    
                        | 893. BUC Union | 
                    
                    
                    
                        | 894. BUL Union elbow | 
                    
                    
                    
                        | 895. PCV Induction check valve model indication instructions | 
                    
                    
                    
                        | 896. PHK Swivel reducer bottom bracket | 
                    
                    
                    
                        | 897. PHD rotatable reducing diameter six-way joint | 
                    
                    
                    
                        | 898. M Barb Coupling for Hose | 
                    
                    
                    
                        | 899. M Screw plug | 
                    
                    
                    
                        | 900. M Extension connector | 
                    
                    
                    
                        | 901. M Barb elbow for hose | 
                    
                    
                    
                        | 902. M Barb elbow for hose(H) | 
                    
                    
                    
                        | 903. M Universal elbow | 
                    
                    
                    
                        | 904. M Universal T-joint | 
                    
                    
                    
                        | 905. M Hose elbow | 
                    
                    
                    
                        | 906. M Hose Locking Fitting | 
                    
                    
                    
                        | 907. M Hose elbow(H) | 
                    
                    
                    
                        | 908. M Straight locking connecttor | 
                    
                    
                    
                        | 909. KM11 | 
                    
                    
                    
                        | 910. KM12 | 
                    
                    
                    
                        | 911. KM13 | 
                    
                    
                    
                        | 912. KM14 | 
                    
                    
                    
                        | 913. SY-C | 
                    
                    
                    
                        | 914. SY-L | 
                    
                    
                    
                        | 915. BP Series | 
                    
                    
                    
                        | 916. BP-G Series | 
                    
                    
                    
                        | 917. BB Series | 
                    
                    
                    
                        | 918. BD Series | 
                    
                    
                    
                        | 919. BU Series | 
                    
                    
                    
                        | 920. B-BZ Series | 
                    
                    
                    
                        | 921. AN05-40 Series | 
                    
                    
                    
                        | 922. PSU Series | 
                    
                    
                    
                        | 923. PAL Series | 
                    
                    
                    
                        | 924. PSL Series | 
                    
                    
                    
                        | 925. BSLM Series | 
                    
                    
                    
                        | 926. BSL Series | 
                    
                    
                    
                        | 927. Machining-1 | 
                    
                    
                    
                        | 928. Machining-2 | 
                    
                    
                    
                        | 929. Machining-3 | 
                    
                    
                    
                        | 930. Machining-4 | 
                    
                    
                    
                        | 931. Machining-5 | 
                    
                    
                    
                        | 932. Machining-6 | 
                    
                    
                    
                        | 933. Machining-7 | 
                    
                    
                    
                        | 934. Machining-8 | 
                    
                    
                    
                        | 935. Machining-9 | 
                    
                    
                    
                        | 936. Machining-10 | 
                    
                    
                    
                        | 937. Machining-11 | 
                    
                    
                    
                        | 938. Machining-12 | 
                    
                    
                    
                        | 939. Machining-13 | 
                    
                    
                    
                        | 940. Machining-14 | 
                    
                    
                    
                        | 941. Machining-15 | 
                    
                    
                    
                        | 942. Machining-16 | 
                    
                    
                    
                        | 943. Machining-17 | 
                    
                    
                    
                        | 944. Machining-18 | 
                    
                    
                    
                        | 945. Machining-19 | 
                    
                    
                    
                        | 946. Machining-20 | 
                    
                    
                    
                        | 947. Machining-21 | 
                    
                    
                    
                        | 948. Machining-22 | 
                    
                    
                    
                        | 949. Machining-23 | 
                    
                    
                    
                        | 950. Machining-24 | 
                    
                    
                    
                        | 951. Machining-25 | 
                    
                    
                    
                        | 952. Machining-26 | 
                    
                    
                    
                        | 953. Machining-27 | 
                    
                    
                    
                        | 954. Machining-28 | 
                    
                    
                    
                        | 955. Machining-29 | 
                    
                    
                    
                        | 956. Machining-30 | 
                    
                    
                    
                        | 957. Machining-31 | 
                    
                    
                    
                        | 958. Machining-32 | 
                    
                    
                    
                        | 959. Machining-33 | 
                    
                    
                    
                        | 960. Machining-34 | 
                    
                    
                    
                        | 961. Machining-35 | 
                    
                    
                    
                        | 962. Machining-36 | 
                    
                    
                    
                        | 963. Machining-37 | 
                    
                    
                    
                        | 964. Machining-38 | 
                    
                    
                    
                        | 965. Machining-39 | 
                    
                    
                    
                        | 966. Machining-40 | 
                    
                    
                    
                        | 967. Machining-41 | 
                    
                    
                    
                        | 968. Machining-42 | 
                    
                    
                    
                        | 969. Machining-43 | 
                    
                    
                    
                        | 970. Machining-44 | 
                    
                    
                    
                        | 971. Machining-45 | 
                    
                    
                    
                        | 972. Machining-46 | 
                    
                    
                    
                        | 973. Machining-47 | 
                    
                    
                    
                        | 974. Machining-48 | 
                    
                    
                    
                        | 975. Machining-49 | 
                    
                    
                    
                        | 976. Machining-50 | 
                    
                    
                    
                        | 977. 5G Base Station Fittings | 
                    
                    
                    
                        | 978. Auto Door Lock SeriesTL-ADL001 | 
                    
                    
                    
                        | 979. Auto Door Lock SeriesTL-ADL002 | 
                    
                    
                    
                        | 980. Auto Door Lock SeriesTL-ADL003 | 
                    
                    
                    
                        | 981. Auto Door Lock SeriesTL-ADL004 | 
                    
                    
                    
                        | 982. Auto Door Lock SeriesTL-ADL005 | 
                    
                    
                    
                        | 983. Auto Door Lock SeriesTL-ADL006 | 
                    
                    
                    
                        | 984. Auto Door Lock SeriesTL-ADL007 | 
                    
                    
                    
                        | 985. Auto Door Lock SeriesTL-ADL008 | 
                    
                    
                    
                        | 986. Auto Door Lock SeriesTL-ADL009 | 
                    
                    
                    
                        | 987. Auto Door Lock SeriesTL-ADL010 | 
                    
                    
                    
                        | 988. Auto Door Lock SeriesTL-ADL011 | 
                    
                    
                    
                        | 989. Auto Door Lock SeriesTL-ADL012 | 
                    
                    
                    
                        | 990. Auto Door Lock SeriesTL-ADL013 | 
                    
                    
                    
                        | 991. Auto Door Lock SeriesTL-ADL014 | 
                    
                    
                    
                        | 992. Auto Door Lock SeriesTL-ADL015 | 
                    
                    
                    
                        | 993. Auto Door Lock SeriesTL-ADL016 | 
                    
                    
                    
                        | 994. Auto Door Lock SeriesTL-ADL017 | 
                    
                    
                    
                        | 995. Auto Door Lock SeriesTL-ADL018 | 
                    
                    
                    
                        | 996. Auto Door Lock SeriesTL-ADL019 | 
                    
                    
                    
                        | 997. Coal machine accessories seriesTL-CMA001 | 
                    
                    
                    
                        | 998. Coal machine accessories seriesTL-CMA002 | 
                    
                    
                    
                        | 999. Coal machine accessories seriesTL-CMA003 | 
                    
                    
                    
                        | 1000. Coal machine accessories seriesTL-CMA004 | 
                    
                    
                    
                        | 1001. Coal machine accessories seriesTL-CMA005 | 
                    
                    
                    
                        | 1002. Coal machine accessories seriesTL-CMA006 | 
                    
                    
                    
                        | 1003. Coal machine accessories seriesTL-CMA007 | 
                    
                    
                    
                        | 1004. Coal machine accessories seriesTL-CMA008 | 
                    
                    
                    
                        | 1005. Coal machine accessories seriesTL-CMA009 | 
                    
                    
                    
                        | 1006. Electrical fittings seriesTL-EF001 | 
                    
                    
                    
                        | 1007. Electrical fittings seriesTL-EF002 | 
                    
                    
                    
                        | 1008. Electrical fittings seriesTL-EF003 | 
                    
                    
                    
                        | 1009. Electrical fittings seriesTL-EF004 | 
                    
                    
                    
                        | 1010. Electrical fittings seriesTL-EF005 | 
                    
                    
                    
                        | 1011. Electrical fittings seriesTL-EF006 | 
                    
                    
                    
                        | 1012. Electrical fittings seriesTL-EF007 | 
                    
                    
                    
                        | 1013. Electrical fittings seriesTL-EF008 | 
                    
                    
                    
                        | 1014. Electrical fittings seriesTL-EF009 | 
                    
                    
                    
                        | 1015. Electrical fittings seriesTL-EF010 | 
                    
                    
                    
                        | 1016. Electrical fittings seriesTL-EF011 | 
                    
                    
                    
                        | 1017. Electrical fittings seriesTL-EF012 | 
                    
                    
                    
                        | 1018. Electrical fittings seriesTL-EF013 | 
                    
                    
                    
                        | 1019. Electrical fittings seriesTL-EF014 | 
                    
                    
                    
                        | 1020. Electrical fittings seriesTL-EF015 | 
                    
                    
                    
                        | 1021. Electrical fittings seriesTL-EF016 | 
                    
                    
                    
                        | 1022. Charging pile copperTL-CP009 | 
                    
                    
                    
                        | 1023. Charging pile copperTL-CP010 | 
                    
                    
                    
                        | 1024. Charging pile copperTL-CP011 | 
                    
                    
                    
                        | 1025. Energy storage copper parts seriesTL-CP006 | 
                    
                    
                    
                        | 1026. Energy storage copper parts seriesTL-CP007 | 
                    
                    
                    
                        | 1027. Energy storage copper parts seriesTL-CP008 | 
                    
                    
                    
                        | 1028. quadrilateral spindle | 
                    
                    
                    
                        | 1029. Screws for energy storage copper partsTL-CP001 | 
                    
                    
                    
                        | 1030. Screws for energy storage copper partsTL-CP002 | 
                    
                    
                    
                        | 1031. Screws for energy storage copper partsTL-CP003 | 
                    
                    
                    
                        | 1032. Silicon rectifier copper partsTL-CP004 | 
                    
                    
                    
                        | 1033. Silicon rectifier copper partsTL-CP005 | 
                    
                    
                    
                        | 1034. Engine oil pipe fittingsTL-EOPF001 | 
                    
                    
                    
                        | 1035. Engine oil pipe fittingsTL-EOPF002 | 
                    
                    
                    
                        | 1036. Engine oil pipe fittingsTL-EOPF003 | 
                    
                    
                    
                        | 1037. Multi-position shaped cold heading partsTL-MP001 | 
                    
                    
                    
                        | 1038. Multi-position shaped cold heading partsTL-MP002 | 
                    
                    
                    
                        | 1039. Multi-position shaped cold heading partsTL-MP003 | 
                    
                    
                    
                        | 1040. Multi-position shaped cold heading partsTL-MP004 | 
                    
                    
                    
                        | 1041. Multi-position shaped cold heading partsTL-MP005 | 
                    
                    
                    
                        | 1042. Multi-position shaped cold heading partsTL-MP006 | 
                    
                    
                    
                        | 1043. Shaped copper parts seriesTL-SCP001 | 
                    
                    
                    
                        | 1044. Shaped copper parts seriesTL-SCP002 | 
                    
                    
                    
                        | 1045. Shaped copper parts seriesTL-SCP003 | 
                    
                    
                    
                        | 1046. Shaped copper parts seriesTL-SCP004 | 
                    
                    
                    
                        | 1047. Shaped copper parts seriesTL-SCP005 | 
                    
                    
                    
                        | 1048. Shaped copper parts seriesTL-SCP006 | 
                    
                    
                    
                        | 1049. Shaped copper parts seriesTL-SCP007 | 
                    
                    
                    
                        | 1050. Shaped copper parts seriesTL-SCP008 | 
                    
                    
                    
                        | 1051. Shaped copper parts seriesTL-SCP009 | 
                    
                    
                    
                        | 1052. Shaped copper parts seriesTL-SCP010 | 
                    
                    
                    
                        | 1053. Shaped copper parts seriesTL-SCP011 | 
                    
                    
                    
                        | 1054. Shaped copper parts seriesTL-SCP012 | 
                    
                    
                    
                        | 1055. Shaped copper parts seriesTL-SCP013 | 
                    
                    
                    
                        | 1056. Shaped copper parts seriesTL-SCP014 | 
                    
                    
                    
                        | 1057. Shaped copper parts seriesTL-SCP015 | 
                    
                    
                    
                        | 1058. Shaped copper parts seriesTL-SCP016 | 
                    
                    
                    
                        | 1059. Silicon rectifier copper partsTL-SRC001 | 
                    
                    
                    
                        | 1060. Silicon rectifier copper partsTL-SRC002 | 
                    
                    
                    
                        | 1061. Special-shaped parts seriesTL-SSP001 | 
                    
                    
                    
                        | 1062. Special-shaped parts seriesTL-SSP002 | 
                    
                    
                    
                        | 1063. Special-shaped parts seriesTL-SSP003 | 
                    
                    
                    
                        | 1064. Special-shaped parts seriesTL-SSP004 | 
                    
                    
                    
                        | 1065. Special-shaped parts seriesTL-SSP005 | 
                    
                    
                    
                        | 1066. Special-shaped parts seriesTL-SSP006 | 
                    
                    
                    
                        | 1067. Special-shaped parts seriesTL-SSP007 | 
                    
                    
                    
                        | 1068. Special-shaped parts seriesTL-SSP008 | 
                    
                    
                    
                        | 1069. Special-shaped parts seriesTL-SSP009 | 
                    
                    
                    
                        | 1070. Special-shaped parts seriesTL-SSP010 | 
                    
                    
                    
                        | 1071. Stainless Steel SeriesTL-SS001 | 
                    
                    
                    
                        | 1072. Stainless Steel SeriesTL-SS002 | 
                    
                    
                    
                        | 1073. Stainless Steel SeriesTL-SS003 | 
                    
                    
                    
                        | 1074. Stainless Steel SeriesTL-SS004 | 
                    
                    
                    
                        | 1075. Stainless Steel SeriesTL-SS005 | 
                    
                    
                    
                        | 1076. Tube Gasket | 
                    
                    
                    
                        | 1077. ANTI-THEFT NUT | 
                    
                    
                    
                        | 1078. CAGE NUT C4895-B | 
                    
                    
                    
                        | 1079. conical nut | 
                    
                    
                    
                        | 1080. Extended round nut | 
                    
                    
                    
                        | 1081. FLANGE CAP NUT | 
                    
                    
                    
                        | 1082. Flange metal locking nut GB6187 | 
                    
                    
                    
                        | 1083. flange nut DIN6923 | 
                    
                    
                    
                        | 1084. Flange nylon lock nut GB6183 | 
                    
                    
                    
                        | 1085. Flat bottom flange nut | 
                    
                    
                    
                        | 1086. HEX LONG NUT DIN 6334 | 
                    
                    
                    
                        | 1087. HEX NUT DIN934 | 
                    
                    
                    
                        | 1088. HEX THIN NUT DIN439 | 
                    
                    
                    
                        | 1089. Hexagon double tooth nut | 
                    
                    
                    
                        | 1090. Hexagon welding nut without solder joint | 
                    
                    
                    
                        | 1091. Insulated torque nut | 
                    
                    
                    
                        | 1092. Internal and external half hexagon rivet nut | 
                    
                    
                    
                        | 1093. K NUT | 
                    
                    
                    
                        | 1094. Knurled injection nut | 
                    
                    
                    
                        | 1095. LONG SQUARE NUT | 
                    
                    
                    
                        | 1096. METAL LOCK NUT GB6184 | 
                    
                    
                    
                        | 1097. NYLON CAP NUT | 
                    
                    
                    
                        | 1098. Rivet nut with vertical grain | 
                    
                    
                    
                        | 1099. ROUND NUT GB812 | 
                    
                    
                    
                        | 1100. Self-clinching nut | 
                    
                    
                    
                        | 1101. SQUARE NUT DIN557 | 
                    
                    
                    
                        | 1102. SQUARE WELD NUT DIN928-A | 
                    
                    
                    
                        | 1103. SQUARE WELD NUT DIN928-B | 
                    
                    
                    
                        | 1104. SQUARE WELDING NUT DIN929 | 
                    
                    
                    
                        | 1105. Stainless steel hex nylon lock nut | 
                    
                    
                    
                        | 1106. THICK PREESSURE NUT DIN5587 | 
                    
                    
                    
                        | 1107. Wagon nut | 
                    
                    
                    
                        | 1108. wing nut DIN135 | 
                    
                    
                    
                        | 1109. circlip for hole | 
                    
                    
                    
                        | 1110. circlip for shaft | 
                    
                    
                    
                        | 1111. Disk spring washer | 
                    
                    
                    
                        | 1112. external tab washer | 
                    
                    
                    
                        | 1113. external teeth lock washer | 
                    
                    
                    
                        | 1114. internal teeth lock washers | 
                    
                    
                    
                        | 1115. internal teeth serrated lock washer | 
                    
                    
                    
                        | 1116. Large outside diameter washer | 
                    
                    
                    
                        | 1117. lock washer with double ears | 
                    
                    
                    
                        | 1118. plain washers | 
                    
                    
                    
                        | 1119. Saddle spring cushion | 
                    
                    
                    
                        | 1120. serrated lock washers exteral teeth | 
                    
                    
                    
                        | 1121. single ear anti-motion washer | 
                    
                    
                    
                        | 1122. small washer | 
                    
                    
                    
                        | 1123. Special washer for wood screws type R | 
                    
                    
                    
                        | 1124. Special washer for wood screws type V | 
                    
                    
                    
                        | 1125. split washer | 
                    
                    
                    
                        | 1126. Spring stop pads | 
                    
                    
                    
                        | 1127. spring washer | 
                    
                    
                    
                        | 1128. Spring washers for cylindrical head screws | 
                    
                    
                    
                        | 1129. square taper washer TYPE-I | 
                    
                    
                    
                        | 1130. square taper washer type-u | 
                    
                    
                    
                        | 1131. square washer | 
                    
                    
                    
                        | 1132. Wave spring washers | 
                    
                    
                    
                        | 1133. stud bolt 1D | 
                    
                    
                    
                        | 1134. stud bolt 2D | 
                    
                    
                    
                        | 1135. stud bolt1 25D | 
                    
                    
                    
                        | 1136. THREAD ROD | 
                    
                    
                    
                        | 1137. Electronic stamping parts | 
                    
                    
                    
                        | 1138. Electronic stamping parts | 
                    
                    
                    
                        | 1139. Electronic stamping parts | 
                    
                    
                    
                        | 1140. Electronic stamping parts | 
                    
                    
                    
                        | 1141. Electronic stamping parts | 
                    
                    
                    
                        | 1142. Electronic stamping parts | 
                    
                    
                    
                        | 1143. Electronic stamping parts | 
                    
                    
                    
                        | 1144. MCB Electronic stamping parts | 
                    
                    
                    
                        | 1145. MCCB Electronic stamping parts | 
                    
                    
                    
                        | 1146. Terminal | 
                    
                    
                    
                        | 1147. Maching Parts | 
                    
                    
                    
                        | 1148. Sheet Metal Fabrication Stamping | 
                    
                    
                    
                        | 1149. Aluminum Profiles | 
                    
                    
                    
                        | 1150. Spring | 
                    
                    
                    
                        | 1151. New Energy Vecicle Parts | 
                    
                    
                    
                        | 1152. Mould Customization | 
                    
                    
                    
                        | 1153. USB-A Type | 
                    
                    
                    
                        | 1154. Board To Board Connector | 
                    
                    
                    
                        | 1155. Perforation Board Connector | 
                    
                    
                    
                        | 1156. American stainless steel throat hoop | 
                    
                    
                    
                        | 1157. American stainless steel handle throat hoop | 
                    
                    
                    
                        | 1158. American plastic handle throat hoop | 
                    
                    
                    
                        | 1159. Small American stainless steel throat hoop | 
                    
                    
                    
                        | 1160. European strong throat hoop | 
                    
                    
                    
                        | 1161. Quick release throat hoop | 
                    
                    
                    
                        | 1162. T-type strong throat hoop | 
                    
                    
                    
                        | 1163. German stainless steel throat hoop | 
                    
                    
                    
                        | 1164. Stainless steel riding clip | 
                    
                    
                    
                        | 1165. Stainless steel self-locking strap | 
                    
                    
                    
                        | 1166. Stepped stainless steel tie | 
                    
                    
                    
                        | 1167. Universal stainless steel strap | 
                    
                    
                    
                        | 1168. Loose stainless steel tie | 
                    
                    
                    
                        | 1169. Self-locking nylon tie | 
                    
                    
                    
                        | 1170. Plastic sprayed stainless steel tie | 
                    
                    
                    
                        | 1171. L buckle tape effect | 
                    
                    
                    
                        | 1172. Tooth buckle belt effect | 
                    
                    
                    
                        | 1173. Screw buckle | 
                    
                    
                    
                        | 1174. Tape | 
                    
                    
                    
                        | 1175. Omnipotent clamp | 
                    
                    
                    
                        | 1176. Stainless steel strapping tool | 
                    
                    
                    
                        | 1177. Contour Battery Master Switch A701 | 
                    
                    
                    
                        | 1178. Battery Selector Switch 701S | 
                    
                    
                    
                        | 1179. Panel-Mounted Switch A701-PM,A701S-PM | 
                    
                    
                    
                        | 1180. Heavy-duty Battery Switch | 
                    
                    
                    
                        | 1181. Contour Battery Master Switch | 
                    
                    
                    
                        | 1182. Contour Battery Master Switch | 
                    
                    
                    
                        | 1183. Battery Switch A801/A802 | 
                    
                    
                    
                        | 1184. Battery Selector Switch A803/A804 | 
                    
                    
                    
                        | 1185. Battery Switch A804/A805 | 
                    
                    
                    
                        | 1186. Heavy duty Battery Switch A806 | 
                    
                    
                    
                        | 1187. Battery Switch A901/A902 | 
                    
                    
                    
                        | 1188. Battery Switch A903/A904 | 
                    
                    
                    
                        | 1189. Knife-blade Switch A1001,A1002 | 
                    
                    
                    
                        | 1190. Battery Switch 56-00026,56-00028 | 
                    
                    
                    
                        | 1191. Battery Switch 56-00027,56-00029 | 
                    
                    
                    
                        | 1192. Battery to Starter | 
                    
                    
                    
                        | 1193. Top Terminal Battery Cables | 
                    
                    
                    
                        | 1194. Side Terminal Battery Cables | 
                    
                    
                    
                        | 1195. Harness Repair Splice A88 | 
                    
                    
                    
                        | 1196. Jumper Cable A900/A1000 | 
                    
                    
                    
                        | 1197. Battery Isolator | 
                    
                    
                    
                        | 1198. Anderson Plugs | 
                    
                    
                    
                        | 1199. Standard Copper Lugs | 
                    
                    
                    
                        | 1200. Erminal Boot PVC | 
                    
                    
                    
                        | 1201. OE Battery Terminal | 
                    
                    
                    
                        | 1202. Brass battery Terminal | 
                    
                    
                    
                        | 1203. Zinc battery terminal | 
                    
                    
                    
                        | 1204. Lead battery terminal | 
                    
                    
                    
                        | 1205. Booster Cable | 
                    
                    
                    
                        | 1206. Battery Clamp | 
                    
                    
                    
                        | 1207. Battery Accessories | 
                    
                    
                    
                        | 1208. KL-1001 | 
                    
                    
                    
                        | 1209. KL-1002 | 
                    
                    
                    
                        | 1210. KL-1003 | 
                    
                    
                    
                        | 1211. KL-1004 | 
                    
                    
                    
                        | 1212. KL-1005 | 
                    
                    
                    
                        | 1213. KL-1006 | 
                    
                    
                    
                        | 1214. KL-1007 | 
                    
                    
                    
                        | 1215. KL-1008 | 
                    
                    
                    
                        | 1216. KL-1009 | 
                    
                    
                    
                        | 1217. KL-1010 | 
                    
                    
                    
                        | 1218. KL-1011 | 
                    
                    
                    
                        | 1219. KL-1012 | 
                    
                    
                    
                        | 1220. KL-1013 | 
                    
                    
                    
                        | 1221. KL-1014 | 
                    
                    
                    
                        | 1222. KL-1015 | 
                    
                    
                    
                        | 1223. KL-1016 | 
                    
                    
                    
                        | 1224. KL-1017 | 
                    
                    
                    
                        | 1225. KL-1018 | 
                    
                    
                    
                        | 1226. KL-1019 | 
                    
                    
                    
                        | 1227. KL-1020 | 
                    
                    
                    
                        | 1228. KL-1021 | 
                    
                    
                    
                        | 1229. KL-1022 | 
                    
                    
                    
                        | 1230. KL-1023 | 
                    
                    
                    
                        | 1231. KL-1024 | 
                    
                    
                    
                        | 1232. KL-1025 | 
                    
                    
                    
                        | 1233. KL-1026 | 
                    
                    
                    
                        | 1234. KL-1027 | 
                    
                    
                    
                        | 1235. KL-1028 | 
                    
                    
                    
                        | 1236. KL-1029 | 
                    
                    
                    
                        | 1237. KL-1030 | 
                    
                    
                    
                        | 1238. KL-1031 | 
                    
                    
                    
                        | 1239. KL-1032 | 
                    
                    
                    
                        | 1240. KL-1033 | 
                    
                    
                    
                        | 1241. KL-1034 | 
                    
                    
                    
                        | 1242. KL-1035 | 
                    
                    
                    
                        | 1243. KL-1036 | 
                    
                    
                    
                        | 1244. KL-1037 | 
                    
                    
                    
                        | 1245. KL-1038 | 
                    
                    
                    
                        | 1246. KL-1038A | 
                    
                    
                    
                        | 1247. KL-1039A | 
                    
                    
                    
                        | 1248. KL-1039 | 
                    
                    
                    
                        | 1249. KL-1040 | 
                    
                    
                    
                        | 1250. KL-1041 | 
                    
                    
                    
                        | 1251. KL-1042 | 
                    
                    
                    
                        | 1252. KL-1043 | 
                    
                    
                    
                        | 1253. KL-1044 | 
                    
                    
                    
                        | 1254. KL-1045 | 
                    
                    
                    
                        | 1255. KL-1046 | 
                    
                    
                    
                        | 1256. KL-1047 | 
                    
                    
                    
                        | 1257. KL-1048 | 
                    
                    
                    
                        | 1258. KL-1049 | 
                    
                    
                    
                        | 1259. KL-1050 | 
                    
                    
                    
                        | 1260. KL-1051 | 
                    
                    
                    
                        | 1261. KL-1052 | 
                    
                    
                    
                        | 1262. KL-1053 | 
                    
                    
                    
                        | 1263. KL-1054 | 
                    
                    
                    
                        | 1264. KL-1055 | 
                    
                    
                    
                        | 1265. KL-1056 | 
                    
                    
                    
                        | 1266. KL-1057 | 
                    
                    
                    
                        | 1267. KL-1058 | 
                    
                    
                    
                        | 1268. KL-1059 | 
                    
                    
                    
                        | 1269. KL-1060 | 
                    
                    
                    
                        | 1270. KL-1061 | 
                    
                    
                    
                        | 1271. KL-1062 | 
                    
                    
                    
                        | 1272. KL-1063 | 
                    
                    
                    
                        | 1273. KL-1064 | 
                    
                    
                    
                        | 1274. KL-1065 | 
                    
                    
                    
                        | 1275. KL-1066 | 
                    
                    
                    
                        | 1276. KL-1067 | 
                    
                    
                    
                        | 1277. KL-1068 | 
                    
                    
                    
                        | 1278. KL-1069 | 
                    
                    
                    
                        | 1279. KL-1070 | 
                    
                    
                    
                        | 1280. KL-1071 | 
                    
                    
                    
                        | 1281. KL-1072 | 
                    
                    
                    
                        | 1282. KL-1073 | 
                    
                    
                    
                        | 1283. KL-1074 | 
                    
                    
                    
                        | 1284. KL-1075 | 
                    
                    
                    
                        | 1285. KL-1076 | 
                    
                    
                    
                        | 1286. KL-1077 | 
                    
                    
                    
                        | 1287. KL-1078 | 
                    
                    
                    
                        | 1288. KL-1079 | 
                    
                    
                    
                        | 1289. KL-1080 | 
                    
                    
                    
                        | 1290. KL-1081 | 
                    
                    
                    
                        | 1291. KL-1082 | 
                    
                    
                    
                        | 1292. KL-1083 | 
                    
                    
                    
                        | 1293. KL-1084 | 
                    
                    
                    
                        | 1294. KL-1085 | 
                    
                    
                    
                        | 1295. KL-1086 | 
                    
                    
                    
                        | 1296. KL-1087 | 
                    
                    
                    
                        | 1297. KL-1088 | 
                    
                    
                    
                        | 1298. KL-1089 | 
                    
                    
                    
                        | 1299. KL-1090 | 
                    
                    
                    
                        | 1300. KL-2011 | 
                    
                    
                    
                        | 1301. KL-2012 | 
                    
                    
                    
                        | 1302. KL-2013 | 
                    
                    
                    
                        | 1303. KL-2014 | 
                    
                    
                    
                        | 1304. KL-2015 | 
                    
                    
                    
                        | 1305. KL-2016 | 
                    
                    
                    
                        | 1306. KL-2017 | 
                    
                    
                    
                        | 1307. KL-2018 | 
                    
                    
                    
                        | 1308. KL-2019 | 
                    
                    
                    
                        | 1309. KL-2020 | 
                    
                    
                    
                        | 1310. KL-2021 | 
                    
                    
                    
                        | 1311. KL-2022 | 
                    
                    
                    
                        | 1312. KL-2023 | 
                    
                    
                    
                        | 1313. KL-2024 | 
                    
                    
                    
                        | 1314. KL-2025 | 
                    
                    
                    
                        | 1315. KL-2026 | 
                    
                    
                    
                        | 1316. KL-2027 | 
                    
                    
                    
                        | 1317. KL-2028 | 
                    
                    
                    
                        | 1318. KL-2029 | 
                    
                    
                    
                        | 1319. KL-2030 | 
                    
                    
                    
                        | 1320. KL-2031 | 
                    
                    
                    
                        | 1321. KL-2032 | 
                    
                    
                    
                        | 1322. KL-2033 | 
                    
                    
                    
                        | 1323. KL-2034 | 
                    
                    
                    
                        | 1324. KL-2035 | 
                    
                    
                    
                        | 1325. KL-3001 | 
                    
                    
                    
                        | 1326. KL-3002 | 
                    
                    
                    
                        | 1327. KL-3003 | 
                    
                    
                    
                        | 1328. KL-3004 | 
                    
                    
                    
                        | 1329. KL-3005 | 
                    
                    
                    
                        | 1330. KL-3006 | 
                    
                    
                    
                        | 1331. KL-3007 | 
                    
                    
                    
                        | 1332. KL-3008 | 
                    
                    
                    
                        | 1333. KL-3009 | 
                    
                    
                    
                        | 1334. KL-3010 | 
                    
                    
                    
                        | 1335. KL-3011 | 
                    
                    
                    
                        | 1336. KL-3012 | 
                    
                    
                    
                        | 1337. KL-3013 | 
                    
                    
                    
                        | 1338. KL-3014 | 
                    
                    
                    
                        | 1339. KL-3015 | 
                    
                    
                    
                        | 1340. KL-3016 | 
                    
                    
                    
                        | 1341. KL-3017 | 
                    
                    
                    
                        | 1342. KL-3018 | 
                    
                    
                    
                        | 1343. KL-3019 | 
                    
                    
                    
                        | 1344. KL-3020 | 
                    
                    
                    
                        | 1345. KL-3021 | 
                    
                    
                    
                        | 1346. KL-3022 | 
                    
                    
                    
                        | 1347. KL-3023 | 
                    
                    
                    
                        | 1348. KL-3024 | 
                    
                    
                    
                        | 1349. KL-3025 | 
                    
                    
                    
                        | 1350. KL-3026 | 
                    
                    
                    
                        | 1351. KL-3027 | 
                    
                    
                    
                        | 1352. KL-3028 | 
                    
                    
                    
                        | 1353. KL-3029 | 
                    
                    
                    
                        | 1354. KL-3030 | 
                    
                    
                    
                        | 1355. KL-4001 | 
                    
                    
                    
                        | 1356. KL-4002 | 
                    
                    
                    
                        | 1357. KL-4003 | 
                    
                    
                    
                        | 1358. KL-4004 | 
                    
                    
                    
                        | 1359. KL-4005 | 
                    
                    
                    
                        | 1360. KL-4006 | 
                    
                    
                    
                        | 1361. KL-4007 | 
                    
                    
                    
                        | 1362. KL-4008 | 
                    
                    
                    
                        | 1363. KL-4009 | 
                    
                    
                    
                        | 1364. KL-4010 | 
                    
                    
                    
                        | 1365. KL-4011 | 
                    
                    
                    
                        | 1366. KL-4012 | 
                    
                    
                    
                        | 1367. KL-4013 | 
                    
                    
                    
                        | 1368. KL-4014 | 
                    
                    
                    
                        | 1369. KL-4015 | 
                    
                    
                    
                        | 1370. KL-4016 | 
                    
                    
                    
                        | 1371. KL-4017 | 
                    
                    
                    
                        | 1372. KL-4018 | 
                    
                    
                    
                        | 1373. KL-4019 | 
                    
                    
                    
                        | 1374. KL-4020 | 
                    
                    
                    
                        | 1375. KL-4021 | 
                    
                    
                    
                        | 1376. KL-4022 | 
                    
                    
                    
                        | 1377. KL-4023 | 
                    
                    
                    
                        | 1378. KL-5001 | 
                    
                    
                    
                        | 1379. KL-5002 | 
                    
                    
                    
                        | 1380. KL-5003 | 
                    
                    
                    
                        | 1381. KL-5004 | 
                    
                    
                    
                        | 1382. KL-5005 | 
                    
                    
                    
                        | 1383. KL-5006 | 
                    
                    
                    
                        | 1384. KL-5007 | 
                    
                    
                    
                        | 1385. KL-5008 | 
                    
                    
                    
                        | 1386. KL-5009 | 
                    
                    
                    
                        | 1387. KL-5010 | 
                    
                    
                    
                        | 1388. KL-5011 | 
                    
                    
                    
                        | 1389. KL-5012 | 
                    
                    
                    
                        | 1390. KL-5013 | 
                    
                    
                    
                        | 1391. KL-5014 | 
                    
                    
                    
                        | 1392. KL-5015 | 
                    
                    
                    
                        | 1393. KL-5016 | 
                    
                    
                    
                        | 1394. KL-5017 | 
                    
                    
                    
                        | 1395. KL-5018 | 
                    
                    
                    
                        | 1396. KL-5019 | 
                    
                    
                    
                        | 1397. KL-5020 | 
                    
                    
                    
                        | 1398. KL-5021 | 
                    
                    
                    
                        | 1399. KL-5022 | 
                    
                    
                    
                        | 1400. KL-5023 | 
                    
                    
                    
                        | 1401. KL-5024 | 
                    
                    
                    
                        | 1402. KL-5025 | 
                    
                    
                    
                        | 1403. KL-5026 | 
                    
                    
                    
                        | 1404. KL-5027 | 
                    
                    
                    
                        | 1405. KL-5028 | 
                    
                    
                    
                        | 1406. KL-5029 | 
                    
                    
                    
                        | 1407. KL-5030 | 
                    
                    
                    
                        | 1408. KL-5031 | 
                    
                    
                    
                        | 1409. KL-5032 | 
                    
                    
                    
                        | 1410. KL-5033 | 
                    
                    
                    
                        | 1411. KL-5034 | 
                    
                    
                    
                        | 1412. KL-5035 | 
                    
                    
                    
                        | 1413. KL-5036 | 
                    
                    
                    
                        | 1414. KL-5037 | 
                    
                    
                    
                        | 1415. KL-5038 | 
                    
                    
                    
                        | 1416. KL-5039 | 
                    
                    
                    
                        | 1417. KL-5040 | 
                    
                    
                    
                        | 1418. KL-5041 | 
                    
                    
                    
                        | 1419. KL-5042 | 
                    
                    
                    
                        | 1420. KL-5043 | 
                    
                    
                    
                        | 1421. KL-5044 | 
                    
                    
                    
                        | 1422. KL-5045 | 
                    
                    
                    
                        | 1423. KL-5046 | 
                    
                    
                    
                        | 1424. KL-5047 | 
                    
                    
                    
                        | 1425. KL-5048 | 
                    
                    
                    
                        | 1426. KL-5049 | 
                    
                    
                    
                        | 1427. KL-5050 | 
                    
                    
                    
                        | 1428. KL-5051 | 
                    
                    
                    
                        | 1429. KL-5052 | 
                    
                    
                    
                        | 1430. KL-5053 | 
                    
                    
                    
                        | 1431. KL-5054 | 
                    
                    
                    
                        | 1432. KL-5055 | 
                    
                    
                    
                        | 1433. KL-5056 | 
                    
                    
                    
                        | 1434. KL-5057 | 
                    
                    
                    
                        | 1435. KL-5058 | 
                    
                    
                    
                        | 1436. KL-5059 | 
                    
                    
                    
                        | 1437. KL-5060 | 
                    
                    
                    
                        | 1438. KL-5061 | 
                    
                    
                    
                        | 1439. KL-5062 | 
                    
                    
                    
                        | 1440. KL-5063 | 
                    
                    
                    
                        | 1441. KL-5064 | 
                    
                    
                    
                        | 1442. KL-5065 | 
                    
                    
                    
                        | 1443. KL-5066 | 
                    
                    
                    
                        | 1444. KL-5067 | 
                    
                    
                    
                        | 1445. KL-5068 | 
                    
                    
                    
                        | 1446. KL-5069 | 
                    
                    
                    
                        | 1447. KL-5070 | 
                    
                    
                    
                        | 1448. BE1101 | 
                    
                    
                    
                        | 1449. BE1102 | 
                    
                    
                    
                        | 1450. BE1103 | 
                    
                    
                    
                        | 1451. BE1105 | 
                    
                    
                    
                        | 1452. BE1106 | 
                    
                    
                    
                        | 1453. BE1108 | 
                    
                    
                    
                        | 1454. BE1109 | 
                    
                    
                    
                        | 1455. BE1110 | 
                    
                    
                    
                        | 1456. BE1111 | 
                    
                    
                    
                        | 1457. BE2101 | 
                    
                    
                    
                        | 1458. BE2102 | 
                    
                    
                    
                        | 1459. BE2103 | 
                    
                    
                    
                        | 1460. BE2104 | 
                    
                    
                    
                        | 1461. BE2105 | 
                    
                    
                    
                        | 1462. BE2106 | 
                    
                    
                    
                        | 1463. BE2107 | 
                    
                    
                    
                        | 1464. BE2108 | 
                    
                    
                    
                        | 1465. BE2109 | 
                    
                    
                    
                        | 1466. BE2110 | 
                    
                    
                    
                        | 1467. BE2111 | 
                    
                    
                    
                        | 1468. BE2112 | 
                    
                    
                    
                        | 1469. BE2113 | 
                    
                    
                    
                        | 1470. BE2115 | 
                    
                    
                    
                        | 1471. BE3101 | 
                    
                    
                    
                        | 1472. BE3102 | 
                    
                    
                    
                        | 1473. BE3103 | 
                    
                    
                    
                        | 1474. BE3105 | 
                    
                    
                    
                        | 1475. BE5101 | 
                    
                    
                    
                        | 1476. BE5102 | 
                    
                    
                    
                        | 1477. BE5103 | 
                    
                    
                    
                        | 1478. BE5105 | 
                    
                    
                    
                        | 1479. BE6101 | 
                    
                    
                    
                        | 1480. BE6102 | 
                    
                    
                    
                        | 1481. BE6201 | 
                    
                    
                    
                        | 1482. BE6103 | 
                    
                    
                    
                        | 1483. BE6105 | 
                    
                    
                    
                        | 1484. BE7101 | 
                    
                    
                    
                        | 1485. BE7102 | 
                    
                    
                    
                        | 1486. BE7103 | 
                    
                    
                    
                        | 1487. BE8101 | 
                    
                    
                    
                        | 1488. BE8102 | 
                    
                    
                    
                        | 1489. BE8103 | 
                    
                    
                    
                        | 1490. BE8105 | 
                    
                    
                    
                        | 1491. BE8106 | 
                    
                    
                    
                        | 1492. BE8107 | 
                    
                    
                    
                        | 1493. BE8108 | 
                    
                    
                    
                        | 1494. BE8109 | 
                    
                    
                    
                        | 1495. BE8110 | 
                    
                    
                    
                        | 1496. BE8111 | 
                    
                    
                    
                        | 1497. PO1101 | 
                    
                    
                    
                        | 1498. PO1102 | 
                    
                    
                    
                        | 1499. PO1103 | 
                    
                    
                    
                        | 1500. PO1105 | 
                    
                    
                    
                        | 1501. PO1106 | 
                    
                    
                    
                        | 1502. PO1108 | 
                    
                    
                    
                        | 1503. PO1109 | 
                    
                    
                    
                        | 1504. PO1201 | 
                    
                    
                    
                        | 1505. LP2401 | 
                    
                    
                    
                        | 1506. LP2402 | 
                    
                    
                    
                        | 1507. LP2403 | 
                    
                    
                    
                        | 1508. LP2405 | 
                    
                    
                    
                        | 1509. LP2406 | 
                    
                    
                    
                        | 1510. WM1006 | 
                    
                    
                    
                        | 1511. WM1001 | 
                    
                    
                    
                        | 1512. WM1002 | 
                    
                    
                    
                        | 1513. WM1003 | 
                    
                    
                    
                        | 1514. WM1005 | 
                    
                    
                    
                        | 1515. WH1001 | 
                    
                    
                    
                        | 1516. WH1002 | 
                    
                    
                    
                        | 1517. WH1003 | 
                    
                    
                    
                        | 1518. WH1005 | 
                    
                    
                    
                        | 1519. WH1006 | 
                    
                    
                    
                        | 1520. WH1008 | 
                    
                    
                    
                        | 1521. WH1009 | 
                    
                    
                    
                        | 1522. LE1101H | 
                    
                    
                    
                        | 1523. LE1102H | 
                    
                    
                    
                        | 1524. LE1103H | 
                    
                    
                    
                        | 1525. LE1105H | 
                    
                    
                    
                        | 1526. LE1106H | 
                    
                    
                    
                        | 1527. LE1107H | 
                    
                    
                    
                        | 1528. LE1108H | 
                    
                    
                    
                        | 1529. LE1109H | 
                    
                    
                    
                        | 1530. LE1110H | 
                    
                    
                    
                        | 1531. LE1111H | 
                    
                    
                    
                        | 1532. LE1112H | 
                    
                    
                    
                        | 1533. LE1113H | 
                    
                    
                    
                        | 1534. LE1115H | 
                    
                    
                    
                        | 1535. LE1116H | 
                    
                    
                    
                        | 1536. LP2301 | 
                    
                    
                    
                        | 1537. LP2202 | 
                    
                    
                    
                        | 1538. LP2203 | 
                    
                    
                    
                        | 1539. LP2205 | 
                    
                    
                    
                        | 1540. LP2206 | 
                    
                    
                    
                        | 1541. LP2208 | 
                    
                    
                    
                        | 1542. LP2209 | 
                    
                    
                    
                        | 1543. LP2210 | 
                    
                    
                    
                        | 1544. LP2211 | 
                    
                    
                    
                        | 1545. LP2212 | 
                    
                    
                    
                        | 1546. ST1101 | 
                    
                    
                    
                        | 1547. ST1102 | 
                    
                    
                    
                        | 1548. ST1103 | 
                    
                    
                    
                        | 1549. ST1105 | 
                    
                    
                    
                        | 1550. ST1106 | 
                    
                    
                    
                        | 1551. ST1108 | 
                    
                    
                    
                        | 1552. CH1101 | 
                    
                    
                    
                        | 1553. CH1102 | 
                    
                    
                    
                        | 1554. CH1103 | 
                    
                    
                    
                        | 1555. CH1105 | 
                    
                    
                    
                        | 1556. CH1106 | 
                    
                    
                    
                        | 1557. GH1101 | 
                    
                    
                    
                        | 1558. GH1102 | 
                    
                    
                    
                        | 1559. GH1103 | 
                    
                    
                    
                        | 1560. GH1105 | 
                    
                    
                    
                        | 1561. GH1106 | 
                    
                    
                    
                        | 1562. GH1108 | 
                    
                    
                    
                        | 1563. ZBD101 LED energy efficient explosion-proof lamp | 
                    
                    
                    
                        | 1564. ZBD102 LED energy efficient explosion-proof lamp | 
                    
                    
                    
                        | 1565. ZBD104 LED energy efficient explosion-proof lamp | 
                    
                    
                    
                        | 1566. ZBD107 LED maintenance-free explosion-proof lamp | 
                    
                    
                    
                        | 1567. ZBD111 LED energy efficient explosion-proof lamp | 
                    
                    
                    
                        | 1568. ZBD113 LED explosion-proof flood light | 
                    
                    
                    
                        | 1569. ZBD117 Solid-state maintenance-free explosion-proof lamp | 
                    
                    
                    
                        | 1570. ZBD119 LED Explosion-proof platform light | 
                    
                    
                    
                        | 1571. ZBD124 LED maintenance-free explosion-proof lamp | 
                    
                    
                    
                        | 1572. ZBD126 LED Explosion-proof platform light | 
                    
                    
                    
                        | 1573. ZBD127 LED maintenance-free explosion-proof lamp | 
                    
                    
                    
                        | 1574. ZBD128 LED maintenance-free explosion-proof lamp | 
                    
                    
                    
                        | 1575. ZBD129 LED maintenance-free explosion-proof lamp | 
                    
                    
                    
                        | 1576. ZBD130 LED maintenance-free explosion-proof lamp | 
                    
                    
                    
                        | 1577. ZBD131 LED Explosion-proof platform light | 
                    
                    
                    
                        | 1578. ZBD140 LED maintenance-free explosion-proof lamp | 
                    
                    
                    
                        | 1579. ZBD150 LED maintenance-free explosion-proof lamp | 
                    
                    
                    
                        | 1580. ZBD152 LED maintenance-free explosion-proof lamp | 
                    
                    
                    
                        | 1581. ZBD154 LED maintenance-free explosion-proof lamp | 
                    
                    
                    
                        | 1582. ZBD155 LED maintenance-free explosion-proof lamp | 
                    
                    
                    
                        | 1583. ZBD111L LED Explosion-proof road lamp | 
                    
                    
                    
                        | 1584. ZBD113L LED Explosion-proof road lamp | 
                    
                    
                    
                        | 1585. ZBD150L LED Explosion-proof road lamp | 
                    
                    
                    
                        | 1586. ZBD154L LED Explosion-proof road lamp | 
                    
                    
                    
                        | 1587. ZBD190 Explosion-proof and energy-saving LED light | 
                    
                    
                    
                        | 1588. BAJ52 Explosion-proof emergency light | 
                    
                    
                    
                        | 1589. BAY51 Explosion-proof sign light | 
                    
                    
                    
                        | 1590. BBJ Explosion-proof sound and light alarm | 
                    
                    
                    
                        | 1591. BAK51 LED Explosion-proof Sight Hole Lamp | 
                    
                    
                    
                        | 1592. BPY Explosion-proof fluorescent lamp | 
                    
                    
                    
                        | 1593. BHY Explosion-proof anticorrosive clean fluorescent lamp | 
                    
                    
                    
                        | 1594. BYS Explosion-proof anticorrosion all-plastic fluorescent lamp | 
                    
                    
                    
                        | 1595. ZBD111L Solar explosion-proof street light | 
                    
                    
                    
                        | 1596. ZBF801 Explosion proof Infield Floodlight | 
                    
                    
                    
                        | 1597. ZBF803 Explosion-proof platform light | 
                    
                    
                    
                        | 1598. ZBF804 Explosion-proof platform light | 
                    
                    
                    
                        | 1599. ZBF805 Explosion-proof platform light | 
                    
                    
                    
                        | 1600. ZBF806 Explosion-proof platform light | 
                    
                    
                    
                        | 1601. ZBF808 Explosion-proof flood light | 
                    
                    
                    
                        | 1602. ZBF811 Explosion-proof flood light | 
                    
                    
                    
                        | 1603. ZBF812 Explosion-proof flood light | 
                    
                    
                    
                        | 1604. ZBF813 Explosion-proof flood light | 
                    
                    
                    
                        | 1605. ZBF815 Explosion-proof flood light | 
                    
                    
                    
                        | 1606. ZJW7302 Miniature explosion-proof torch | 
                    
                    
                    
                        | 1607. ZJW7620 Solid-state miniature bright explosion-proof torch | 
                    
                    
                    
                        | 1608. ZJW7623 Multi-functional explosion-proof bright inspection torch | 
                    
                    
                    
                        | 1609. ZJW7625 High power explosion proof torch | 
                    
                    
                    
                        | 1610. ZJW7633 Multi-functional bright explosion-proof torch | 
                    
                    
                    
                        | 1611. ZAD206-J Light weight explosion-proof torch | 
                    
                    
                    
                        | 1612. ZJW7210 Energy-saving bright explosion-proof torch | 
                    
                    
                    
                        | 1613. ZJW7102 Portable explosion-proof searchlight | 
                    
                    
                    
                        | 1614. ZJW7103 Portable explosion-proof searchlight | 
                    
                    
                    
                        | 1615. ZJW7106 Multi-functional explosion-proof portable lamp | 
                    
                    
                    
                        | 1616. ZJIW5281 Light weight multifunctional bright light | 
                    
                    
                    
                        | 1617. ZJIW5282 Light weight multifunctional bright light | 
                    
                    
                    
                        | 1618. ZIW5100 Portable strong light explosion-proof work light | 
                    
                    
                    
                        | 1619. ZAD-301 Explosion-proofstrong light work light | 
                    
                    
                    
                        | 1620. ZJW7400A/LT Multi-function magnetic work light | 
                    
                    
                    
                        | 1621. GAD329 Multi-function work light | 
                    
                    
                    
                        | 1622. ZFW6601 Inspection work light | 
                    
                    
                    
                        | 1623. ZFL4800 Strong explosion-proof azimuthal light | 
                    
                    
                    
                        | 1624. ZIW5130 Miniature explosion-proof headlamp | 
                    
                    
                    
                        | 1625. ZIW5133 Miniature explosion-proof headlamp | 
                    
                    
                    
                        | 1626. ZIW5133B Miniature explosion-proof headlamp | 
                    
                    
                    
                        | 1627. ZIW5135 Multifunctional explosion-proof headlamp | 
                    
                    
                    
                        | 1628. ZIW5136 Multi-function camera light | 
                    
                    
                    
                        | 1629. ZA308E Explosion-proof dimmable work headlamp | 
                    
                    
                    
                        | 1630. ZA309 Polyflood explosion-proof headlamp | 
                    
                    
                    
                        | 1631. ZA310 Multifunctional whistle shoulder light | 
                    
                    
                    
                        | 1632. ZFW6102(A) Explosion-proof floodlight work light | 
                    
                    
                    
                        | 1633. ZFW6102(B) Explosion-proof floodlight work light | 
                    
                    
                    
                        | 1634. ZFW6102(C) Explosion-proof floodlight work light | 
                    
                    
                    
                        | 1635. ZSW2600 Explosion-proof floodlight work light | 
                    
                    
                    
                        | 1636. ZFW6117 LED explosion-proof light weight portable lamp | 
                    
                    
                    
                        | 1637. ZFW6320 Portable LED working lamp | 
                    
                    
                    
                        | 1638. ZT518 Remote Control Car Searchlight | 
                    
                    
                    
                        | 1639. ZGD201 LED anti-glare flood light | 
                    
                    
                    
                        | 1640. ZGD202 LED top light | 
                    
                    
                    
                        | 1641. ZGD203 LED top light | 
                    
                    
                    
                        | 1642. ZGD204 LED low bay light | 
                    
                    
                    
                        | 1643. ZGD207 LED anti-glare platform light | 
                    
                    
                    
                        | 1644. ZGD208 LED anti-glare platform light | 
                    
                    
                    
                        | 1645. ZGD209 LED high bay light | 
                    
                    
                    
                        | 1646. ZGD215 LED flood light | 
                    
                    
                    
                        | 1647. ZGD218 LED flood light | 
                    
                    
                    
                        | 1648. ZGD221 Energy efficient LED light | 
                    
                    
                    
                        | 1649. ZGD225 LED panel light | 
                    
                    
                    
                        | 1650. ZGD231 LED platform light | 
                    
                    
                    
                        | 1651. ZGD234 LED flood light | 
                    
                    
                    
                        | 1652. ZGD245 LED flood light | 
                    
                    
                    
                        | 1653. ZGD246 LED flood light | 
                    
                    
                    
                        | 1654. ZGD251 LED flood light | 
                    
                    
                    
                        | 1655. ZGD254 LED flood light | 
                    
                    
                    
                        | 1656. ZGD262 LED road lamp | 
                    
                    
                    
                        | 1657. ZGD263 LED road lamp | 
                    
                    
                    
                        | 1658. ZGD292 LED road lamp | 
                    
                    
                    
                        | 1659. ZGD268 LED high bay light | 
                    
                    
                    
                        | 1660. ZGD271 LED high bay light | 
                    
                    
                    
                        | 1661. ZGD272 LED high bay light | 
                    
                    
                    
                        | 1662. ZGF601 Anti-glare flood light | 
                    
                    
                    
                        | 1663. ZGF603 Anti-glare canopy light | 
                    
                    
                    
                        | 1664. ZGF604 Anti-glare street light | 
                    
                    
                    
                        | 1665. ZGF605 Anti-glare street light | 
                    
                    
                    
                        | 1666. ZGF606 Vibration-proof Flood light | 
                    
                    
                    
                        | 1667. ZGF607 High bay light | 
                    
                    
                    
                        | 1668. ZGF608 Energy-saving flood light | 
                    
                    
                    
                        | 1669. ZGF609 Waterproof,dustproof,shockproof flood light | 
                    
                    
                    
                        | 1670. ZGF701 Longevity Ceiling Light | 
                    
                    
                    
                        | 1671. ZGF702 Longevity Ceiling Light | 
                    
                    
                    
                        | 1672. ZJW7622/HZ Multi-functional strong light inspection torch | 
                    
                    
                    
                        | 1673. ZJW7632 Multi-functional strong light inspection torch | 
                    
                    
                    
                        | 1674. ZBY980 Powerful zoom flashlight | 
                    
                    
                    
                        | 1675. ZMSL4730 Portable Signal Lamp | 
                    
                    
                    
                        | 1676. ZFL4830C/E Double-sided azimuth light | 
                    
                    
                    
                        | 1677. ZFL4841 illuminated baton | 
                    
                    
                    
                        | 1678. ZFL4870/LZ2 Multi-function emergency light | 
                    
                    
                    
                        | 1679. ZIW5500 Hand-heldlong distance strong light searchlight | 
                    
                    
                    
                        | 1680. ZIW5510 Hand cranked long distance strong light searchlight | 
                    
                    
                    
                        | 1681. ZSW2186 Multi-function flood light | 
                    
                    
                    
                        | 1682. ZFW6105(A) Lightweight portable light | 
                    
                    
                    
                        | 1683. ZFW6105(B) Lightweight portable light | 
                    
                    
                    
                        | 1684. ZFW6330 Lightweight work light | 
                    
                    
                    
                        | 1685. ZJW7116 Multi-function camera recorder patrol light | 
                    
                    
                    
                        | 1686. ZJW7118 Multi-function camera flash light | 
                    
                    
                    
                        | 1687. ZFW6213 Remote Control Vehicle Searchlight | 
                    
                    
                    
                        | 1688. ZFW6325 LED working lamp | 
                    
                    
                    
                        | 1689. ZFW7402 Portable energy storage power supply | 
                    
                    
                    
                        | 1690. ZFW6122 Portable LED working lamp | 
                    
                    
                    
                        | 1691. ZFW6123 Portable LED working lamp | 
                    
                    
                    
                        | 1692. ZFW6108 Mobile lighting system | 
                    
                    
                    
                        | 1693. ZFW6116 LED lightweight portable light | 
                    
                    
                    
                        | 1694. ZFW6119 Multi-functional mobile lighting platform | 
                    
                    
                    
                        | 1695. ZSFW6121 Multi-functional lifting work light | 
                    
                    
                    
                        | 1696. ZFW6128 Multi-functional portable lighting system | 
                    
                    
                    
                        | 1697. ZFW6179 Intelligent Mobile Lighting Tower | 
                    
                    
                    
                        | 1698. ZSFW6110D All-Round automatic flood work light | 
                    
                    
                    
                        | 1699. ZSFW6110J/B All-Round automatic flood work light | 
                    
                    
                    
                        | 1700. ZSFW6110Q Metal Halide Lamp Balloon Light | 
                    
                    
                    
                        | 1701. ZSFW6178 Auto Loading And Unloading Mobile Drainage Cabin | 
                    
                    
                    
                        | 1702. ZSFW6179 Auto loading and unloading mobile charging cabin | 
                    
                    
                    
                        | 1703. ZSFW6180 Solar Movable Lighting Tower | 
                    
                    
                    
                        | 1704. ZSFW6130 Omni-directional movable lighting tower | 
                    
                    
                    
                        | 1705. ZSFW6132 LED Omni-directional movable work light | 
                    
                    
                    
                        | 1706. BZC51 Explosion-proof Operation Column(IIB/IIIB) | 
                    
                    
                    
                        | 1707. BZC51 Explosion-proof Operation Column(IIC/IIIC) | 
                    
                    
                    
                        | 1708. BZA53 Explosion-proof control(IIB/IIC/IIIB/IIIC) | 
                    
                    
                    
                        | 1709. BZC8030 Explosion-proofand anti-corrosion control buttons(IIB/IIIB) | 
                    
                    
                    
                        | 1710. BXK Explosion-proof control box(IIB/IIC/IIIB/IIIC) | 
                    
                    
                    
                        | 1711. BXM(D) Explosion-prooflighting (power) distribution box(IIB/IIC/IIIB/IIIC) | 
                    
                    
                    
                        | 1712. BXQ-T Explosion-proof power (electromagnetic) starter box(IIB/IIC/IIIB/IIIC) | 
                    
                    
                    
                        | 1713. BJD Explosion-proof power maintenance box(IIB/IIC/IIIB/IIIC) | 
                    
                    
                    
                        | 1714. BXC Explosion-proof maintenance poweroutlet box(IIB/IIC/IIIB/IIIC) | 
                    
                    
                    
                        | 1715. BLK51 Explosion-proof circuit breaker(IIB/IIC/IIIB/IIIC) | 
                    
                    
                    
                        | 1716. BQD51 Explosion-proof magnetic starter(IIB/IIC) | 
                    
                    
                    
                        | 1717. BBK Explosion-proof transformer (IIB/IIC/IIIB/IIIC) | 
                    
                    
                    
                        | 1718. BJX Explosion-proof junction box (IIB/IIC/e/IIIB/IIIC) | 
                    
                    
                    
                        | 1719. BQJ Explosion-proof self-coupling buck electromagnetic starter box(IIB/IIIB) | 
                    
                    
                    
                        | 1720. BQXR Explosion-proof star triangle starter(IIB/IIIB) | 
                    
                    
                    
                        | 1721. BQXB Explosion-proof frequency converter(ⅡB/IIIB) | 
                    
                    
                    
                        | 1722. BXK-T Non-standard box (IIB/IIIB) | 
                    
                    
                    
                        | 1723. PXK Positive pressure type explosion-proof distribution cabinet(p) | 
                    
                    
                    
                        | 1724. BSK Explosion-proof distribution cabinet(ⅡB/ⅡC/IIIB/IIIC) | 
                    
                    
                    
                        | 1725. BHZ Explosion-proof transfer switches(IIB/IIIB) | 
                    
                    
                    
                        | 1726. BLX5 Explosion-proof trip switche(IIB/IIIB) | 
                    
                    
                    
                        | 1727. AC Explosion-proof plug (IIB/IIC/IIIB/IIIC) | 
                    
                    
                    
                        | 1728. BDL Explosion-proof electric bell(IIB/IIIB | 
                    
                    
                    
                        | 1729. BYB Explosion-proof ammeter(IIB/IIIB) | 
                    
                    
                    
                        | 1730. BDH Explosion-proof telephone | 
                    
                    
                    
                        | 1731. BK□R Explosion-proof air conditioner(IIB/IIC/IIIB/IIIC) | 
                    
                    
                    
                        | 1732. BKG Explosion-proof lighting switch(IIB//IIIB) | 
                    
                    
                    
                        | 1733. BXF8050 Explosion-proof and anti-corrosive master controller(IIC) | 
                    
                    
                    
                        | 1734. BXK8030 Explosion-proof and anti-corrosion control box(IIC) | 
                    
                    
                    
                        | 1735. BZC8050 Explosion-proof and anti-corrosion operation column(IIC) | 
                    
                    
                    
                        | 1736. BHZ8050 Explosion-proof and anti-corrosion transferswitches(IIC) | 
                    
                    
                    
                        | 1737. BYB8050 Explosion-proof and anti-corrosion control device ammeter(e) | 
                    
                    
                    
                        | 1738. BZM8030 Explosion-proof and anti-corrosion lighting switch(IIC) | 
                    
                    
                    
                        | 1739. BXX8050 Explosion-proof and anti-corrosion plug and socket box(IIC) | 
                    
                    
                    
                        | 1740. BJX8030 Explosion-proof and anti-corrosion junction box(IIC) | 
                    
                    
                    
                        | 1741. BCZ8050 Explosion-proof and anti-corrosion socket(IIC) | 
                    
                    
                    
                        | 1742. DQM Cable Clamping Glands (Exd IIC/IIIC) | 
                    
                    
                    
                        | 1743. BNG Explosion-proof flexible connecting hose(Exd IIC/IIIC) | 
                    
                    
                    
                        | 1744. AH(BHD51) Explosion-proof junction box (ⅡB/ⅡC/IIIB/IIIC) | 
                    
                    
                    
                        | 1745. BFC51(BHC) Explosion-proof threading box | 
                    
                    
                    
                        | 1746. BAG Explosion-proof isolation seal box(Exd IIC) | 
                    
                    
                    
                        | 1747. BGJ Explosion-proof pipe fittings(Exd IIC) | 
                    
                    
                    
                        | 1748. BHJ Explosion-proof connector(Exd IIC) | 
                    
                    
                    
                        | 1749. BAS51-400 Explosion-proof ceiling fan(IIB/IIIB) | 
                    
                    
                    
                        | 1750. CBF Explosion-proof axialfan(IIB/IIIB) | 
                    
                    
                    
                        | 1751. BTS Explosion-proof oscillating fan(IIB/IIIB) | 
                    
                    
                    
                        | 1752. FAG Explosion-proof wall exhaust fan(IIB/IIIB) | 
                    
                    
                    
                        | 1753. Customized Electrical Cabinet | 
                    
                    
                    
                        | 1754. Distribution Box | 
                    
                    
                    
                        | 1755. Electric Control Cabinet | 
                    
                    
                    
                        | 1756. Metal Distribution Electrical Cabinet | 
                    
                    
                    
                        | 1757. DCT-F130 Recessed Floor Socket | 
                    
                    
                    
                        | 1758. DCT-F131 Recessed Floor Socket | 
                    
                    
                    
                        | 1759. DCT-F132 Recessed Floor Socket | 
                    
                    
                    
                        | 1760. DCT-F133 Recessed Floor Socket | 
                    
                    
                    
                        | 1761. DCT-F134 Recessed Floor Socket | 
                    
                    
                    
                        | 1762. Ex Anti-corrosion Control Box | 
                    
                    
                    
                        | 1763. Ex Anti-corrosion Distribution Box | 
                    
                    
                    
                        | 1764. Ex Anti-corrosion Junction Box | 
                    
                    
                    
                        | 1765. Ex Anti-corrosion Maintenance Box | 
                    
                    
                    
                        | 1766. Ex Circuit Breaker | 
                    
                    
                    
                        | 1767. Ex Control Box | 
                    
                    
                    
                        | 1768. Ex Increased Safety Box | 
                    
                    
                    
                        | 1769. Ex Junction Box(Exd Flameproof) | 
                    
                    
                    
                        | 1770. Ex Junction Box(Exe Increased safety enclosure、IIC) | 
                    
                    
                    
                        | 1771. Ex Junction Box(IIC、Ex td) | 
                    
                    
                    
                        | 1772. Ex Lighting(power)Distribution Box | 
                    
                    
                    
                        | 1773. Ex Magnetic Starter | 
                    
                    
                    
                        | 1774. Ex Positive Pressure Enclosure | 
                    
                    
                    
                        | 1775. Ex Power Maintenance Box | 
                    
                    
                    
                        | 1776. Ex Stainless Steel Distribution Box | 
                    
                    
                    
                        | 1777. Ex Stainless Steel Junction Box | 
                    
                    
                    
                        | 1778. Ex Stainless Steel Maintenance Box | 
                    
                    
                    
                        | 1779. Stainless Steel Control Box | 
                    
                    
                    
                        | 1780. Aluminum Box | 
                    
                    
                    
                        | 1781. Aluminum Chassis | 
                    
                    
                    
                        | 1782. Aluminum Electronics Box | 
                    
                    
                    
                        | 1783. Aluminum Enclosure | 
                    
                    
                    
                        | 1784. PT handcart 630A | 
                    
                    
                    
                        | 1785. ZN85-40.5 PT handcart | 
                    
                    
                    
                        | 1786. ZN85-40.5D Isolation handcart | 
                    
                    
                    
                        | 1787. 630A Isolation handcart insulation cylinder type | 
                    
                    
                    
                        | 1788. Metering trolley 630A | 
                    
                    
                    
                        | 1789. ZN85-40.5 Isolation handcart insulation cylinder type | 
                    
                    
                    
                        | 1790. Metering trolley with measuring cylinder 630A | 
                    
                    
                    
                        | 1791. Customized fuse handcart 630A (XRNT) | 
                    
                    
                    
                        | 1792. Fuse handcart 630A(XRNP) | 
                    
                    
                    
                        | 1793. Duckbill PT handcart | 
                    
                    
                    
                        | 1794. Handcart Frame | 
                    
                    
                    
                        | 1795. Two-pole Circuit Breaker Frame | 
                    
                    
                    
                        | 1796. Vacuum Load Isolation And Fuse Combination Electrical Switchgear Frame | 
                    
                    
                    
                        | 1797. VBI Circuit Breaker Frame | 
                    
                    
                    
                        | 1798. VS1 (VBI) Side-Mounted Frame | 
                    
                    
                    
                        | 1799. VS1 Circuit Breaker Frame | 
                    
                    
                    
                        | 1800. ZN85-40.5 Modular Framework | 
                    
                    
                    
                        | 1801. ZN85B-40.5 Frame | 
                    
                    
                    
                        | 1802. ZW32 Chassis | 
                    
                    
                    
                        | 1803. Complete Set Frame | 
                    
                    
                    
                        | 1804. Inflatable Ring Main Unit Frame(325) | 
                    
                    
                    
                        | 1805. Inflatable Ring Main Unit Frame(375) | 
                    
                    
                    
                        | 1806. Metal-clad Switchgear Frame | 
                    
                    
                    
                        | 1807. Metering Cubicle | 
                    
                    
                    
                        | 1808. Solid Ring Main Unit Frame | 
                    
                    
                    
                        | 1809. Solid-Insulated Ring Main Unit frame | 
                    
                    
                    
                        | 1810. VCB Cabinet Frame | 
                    
                    
                    
                        | 1811. Wall-mounted Lithium Battery Enclosure | 
                    
                    
                    
                        | 1812. XGN15-12 Incoming Cabinet Frame | 
                    
                    
                    
                        | 1813. XGN15-12 Outlet Cabinet Frame | 
                    
                    
                    
                        | 1814. CTO1 Type spring operating mechanism | 
                    
                    
                    
                        | 1815. Spring Operating Mechanism(Outlet Mechanism) | 
                    
                    
                    
                        | 1816. Spring Operating Mechanism(Circuit Breaker Mechanism) | 
                    
                    
                    
                        | 1817. CTO2 Type spring operating mechanism | 
                    
                    
                    
                        | 1818. CT☐-☐K Type Spring Operating Mechanism | 
                    
                    
                    
                        | 1819. CT☐-☐A Type Spring Operating Mechanism | 
                    
                    
                    
                        | 1820. FLN36-12D/FLRN36-12D Sf6 Load Switch/SF6 Load Switch-fuse Combination | 
                    
                    
                    
                        | 1821. FLN48-12D/FLRN48-12D Indoor High Voltage SF6 Load Switch | 
                    
                    
                    
                        | 1822. Customized mechanism | 
                    
                    
                    
                        | 1823. DPC Chassis truck definition | 
                    
                    
                    
                        | 1824. DPC-4A-550 Chassis truck outline and installation dimension (match VD4) | 
                    
                    
                    
                        | 1825. DPC-3A-800 Chassis truck outline and installation dimension (match VD4) | 
                    
                    
                    
                        | 1826. DPC-4/4A-口 Chassis truck specification and installation dimension | 
                    
                    
                    
                        | 1827. DPC-5/5A-口 Chassis truck specification and installation dimension (match VBI) | 
                    
                    
                    
                        | 1828. DPC-4-800/XC2 Chassis truck (For low layer) outline and installation dimension | 
                    
                    
                    
                        | 1829. DPC-☐-☐/G/S Chassis truck | 
                    
                    
                    
                        | 1830. DPC-☐-☐H Chassis truck | 
                    
                    
                    
                        | 1831. DDPC-4-800 Outline and installation dimension of electric chassis | 
                    
                    
                    
                        | 1832. Standard guide rail 5LC 260.011 | 
                    
                    
                    
                        | 1833. Aluminum guide rail 5LC260.010 | 
                    
                    
                    
                        | 1834. Guide rail interlocking device 5LC363.011 | 
                    
                    
                    
                        | 1835. Lower earthing interlocking device FLN.5LC.363.016 | 
                    
                    
                    
                        | 1836. Lower door interlocking FLN.5LC.362.016 | 
                    
                    
                    
                        | 1837. Lower door interlocking with two working positions (incoming) FLN.5LC.363.295 | 
                    
                    
                    
                        | 1838. Lower door interlocking with two working positions(outlet) FLN .5LC.363.296 | 
                    
                    
                    
                        | 1839. ZN85 Propulsion mechanism | 
                    
                    
                    
                        | 1840. Earthing switch operation mechanism interlocking device 5LC.363.010.5 | 
                    
                    
                    
                        | 1841. Shutter mechanism 5LC.320.010 (800mm Mid-placed switchgear cabinet) | 
                    
                    
                    
                        | 1842. Shutter mechanism 5LC.320.010.2 (800mm Mid-placed switchgear cabinet) | 
                    
                    
                    
                        | 1843. Shutter mechanism device 5LC.320.010/1ZS | 
                    
                    
                    
                        | 1844. Upside shutter mechanism (800mm/1000mm Wide mid-placed switchgear cabinet) | 
                    
                    
                    
                        | 1845. Shutter mechanism 5LC.320.011 (1000mm Wide mid-placed switchgear cabinet) | 
                    
                    
                    
                        | 1846. shutter mechanism 5LC.320.011.2(Secondary switchgear) (1000mm Mid-placed switchgear) | 
                    
                    
                    
                        | 1847. 35KV shutter mechanism device (Connecting-rod type)11 LC.03.240 | 
                    
                    
                    
                        | 1848. 35KV shutter mechanism device(Guide groove type)11 LC.03.250 | 
                    
                    
                    
                        | 1849. KYN61C Shutter mechanism earthing interlocking device | 
                    
                    
                    
                        | 1850. LC-5-630A(12 pieces) | 
                    
                    
                    
                        | 1851. LC-5-630A(24 pieces) | 
                    
                    
                    
                        | 1852. LC-5-1250A (30 pieces) | 
                    
                    
                    
                        | 1853. LC-5-1600A (36 pieces) | 
                    
                    
                    
                        | 1854. LC-5-2000A (48 pieces) | 
                    
                    
                    
                        | 1855. LC-5-2500A3150A(64 pieces) | 
                    
                    
                    
                        | 1856. LC-5-4000A(82 pieces) | 
                    
                    
                    
                        | 1857. BT.12.108.1/108.2 VS1-12/630A | 
                    
                    
                    
                        | 1858. BT.12.109.1/109.2 VS1-12/1250A | 
                    
                    
                    
                        | 1859. BT.12.110 VS1-12/1600A | 
                    
                    
                    
                        | 1860. BT.12.111 VS1-12/1600A | 
                    
                    
                    
                        | 1861. BT.12.112 VS1-12/2000A | 
                    
                    
                    
                        | 1862. BT.12.113 VS1-12/2000A | 
                    
                    
                    
                        | 1863. BT.12.114 VS1-12/2500A-3150A | 
                    
                    
                    
                        | 1864. BT.12.115 VS1-12/4000A | 
                    
                    
                    
                        | 1865. BT.12.116.1/116.2 VS1-12/630A | 
                    
                    
                    
                        | 1866. BT.12.117.1/117.2 VS1-12/1250A | 
                    
                    
                    
                        | 1867. BT.12.118 VS1-12/1600A | 
                    
                    
                    
                        | 1868. BT.12.119 VS1-12/2000A | 
                    
                    
                    
                        | 1869. BT.12.120 VS1-12/2500A-3150A | 
                    
                    
                    
                        | 1870. BT.12.121.1/121.2 VS1-12/630A | 
                    
                    
                    
                        | 1871. BT.12.122.1/122.2 VS1-12/1250A | 
                    
                    
                    
                        | 1872. BT.12.123  VS1-12/1600A | 
                    
                    
                    
                        | 1873. BT.12.124 VS1-12/2000A | 
                    
                    
                    
                        | 1874. BT.12.125 VS1-12/200A | 
                    
                    
                    
                        | 1875. BT.12.126 VS1-12/2500A-3150A | 
                    
                    
                    
                        | 1876. BT.12.127 VS1-12/3150A | 
                    
                    
                    
                        | 1877. BT.12.128 VS1-12/4000A | 
                    
                    
                    
                        | 1878. 630A Static contact outline | 
                    
                    
                    
                        | 1879. 1250A Static contact outline | 
                    
                    
                    
                        | 1880. 1600A Static contact outline | 
                    
                    
                    
                        | 1881. 1600~2000A Static contact outline | 
                    
                    
                    
                        | 1882. 2500~3150A Static contact outline | 
                    
                    
                    
                        | 1883. 3150~4000A Static contact outline | 
                    
                    
                    
                        | 1884. 35KV Fuseholder | 
                    
                    
                    
                        | 1885. 24KV Fuseholder | 
                    
                    
                    
                        | 1886. 12KV Fuseholder | 
                    
                    
                    
                        | 1887. 12KV OM Fuseholder | 
                    
                    
                    
                        | 1888. 24KV OM Fuseholder | 
                    
                    
                    
                        | 1889. 134 Bushing | 
                    
                    
                    
                        | 1890. 181 Bushing | 
                    
                    
                    
                        | 1891. 202 Bushing | 
                    
                    
                    
                        | 1892. 201 Bushing | 
                    
                    
                    
                        | 1893. 247 Bushing | 
                    
                    
                    
                        | 1894. 256 Bushing | 
                    
                    
                    
                        | 1895. 260 Bushing | 
                    
                    
                    
                        | 1896. 271 Bushing | 
                    
                    
                    
                        | 1897. 284 Bushing | 
                    
                    
                    
                        | 1898. 285 Bushing | 
                    
                    
                    
                        | 1899. 289 Bushing | 
                    
                    
                    
                        | 1900. 144 Bushing | 
                    
                    
                    
                        | 1901. 267 Bushing | 
                    
                    
                    
                        | 1902. 198 Bushing | 
                    
                    
                    
                        | 1903. 281 Bushing | 
                    
                    
                    
                        | 1904. 250A Connect Bushing | 
                    
                    
                    
                        | 1905. 630A Connect Bushing | 
                    
                    
                    
                        | 1906. 630A Connect Bushing | 
                    
                    
                    
                        | 1907. 1250A Connect Bushing | 
                    
                    
                    
                        | 1908. 1250A Connect Bushing | 
                    
                    
                    
                        | 1909. 630A Bushing Plug | 
                    
                    
                    
                        | 1910. 1250A Bushing Plug | 
                    
                    
                    
                        | 1911. 56 Insulation Plug | 
                    
                    
                    
                        | 1912. 58 Insulation Plug | 
                    
                    
                    
                        | 1913. 336 Bushing | 
                    
                    
                    
                        | 1914. 230 Bushing | 
                    
                    
                    
                        | 1915. 102 Insulation Plug | 
                    
                    
                    
                        | 1916. 76 Insulation Plug | 
                    
                    
                    
                        | 1917. 250A Connect Bushing | 
                    
                    
                    
                        | 1918. 630A Connect Bushing | 
                    
                    
                    
                        | 1919. 1250A Connect Bushing | 
                    
                    
                    
                        | 1920. 250A Bushing Plug | 
                    
                    
                    
                        | 1921. Embedded Pole for Circuit Breaker(611G)12kV | 
                    
                    
                    
                        | 1922. Embedded Pole for Circuit Breaker(612G)12kV | 
                    
                    
                    
                        | 1923. Embedded Pole for Circuit Breaker(621G)24kV | 
                    
                    
                    
                        | 1924. Embedded Pole for Circuit Breaker(614G)24kV | 
                    
                    
                    
                        | 1925. Embedded Pole for Circuit Breaker(622G)12kV | 
                    
                    
                    
                        | 1926. Embedded Pole for Circuit Breaker(625G)40.5kV | 
                    
                    
                    
                        | 1927. DXN display with side outgoing line (Opening hole:54x32mm) | 
                    
                    
                    
                        | 1928. DXN display with interlock (Opening hole 54x32mm) | 
                    
                    
                    
                        | 1929. DXN display | 
                    
                    
                    
                        | 1930. DXN-T-II Live display Outline | 
                    
                    
                    
                        | 1931. DXN-Q-Il Live display Outline | 
                    
                    
                    
                        | 1932. DXN8D-Q Live display Outline | 
                    
                    
                    
                        | 1933. DXN8D-Q Live display (pluggable) Outline | 
                    
                    
                    
                        | 1934. DSN-BM(Z/Y) type indoor electromagnetic lock | 
                    
                    
                    
                        | 1935. DSN type indoor electromagnetic lock | 
                    
                    
                    
                        | 1936. DSN-AM indoor electromagnetic lock | 
                    
                    
                    
                        | 1937. Secondary socket with 58 cores | 
                    
                    
                    
                        | 1938. Cabinet light | 
                    
                    
                    
                        | 1939. Latching electromagnet (DC220V/110V) | 
                    
                    
                    
                        | 1940. CM1 Busbar-15 (4-6mm Wire type) | 
                    
                    
                    
                        | 1941. MI1 Busbar (8 Copper bar type) | 
                    
                    
                    
                        | 1942. MJ2 Busbar (6 Copper bar type) | 
                    
                    
                    
                        | 1943. Heater | 
                    
                    
                    
                        | 1944. Explosion-proof (tempered) glass | 
                    
                    
                    
                        | 1945. Rubber retainer | 
                    
                    
                    
                        | 1946. Cable clamp | 
                    
                    
                    
                        | 1947. Three-core cable clamp | 
                    
                    
                    
                        | 1948. single-sided protective coil | 
                    
                    
                    
                        | 1949. pagoda type guard coil | 
                    
                    
                    
                        | 1950. double-sided protective coil | 
                    
                    
                    
                        | 1951. Elliptical Protective Coil | 
                    
                    
                    
                        | 1952. rubber mat | 
                    
                    
                    
                        | 1953. Fixed castor,Directional castor | 
                    
                    
                    
                        | 1954. Advance and retreat signs | 
                    
                    
                    
                        | 1955. 5LC.1505.2000 New emergency opening device | 
                    
                    
                    
                        | 1956. GMSI HV Switchgear cabinet door lock | 
                    
                    
                    
                        | 1957. Padlock and hole location diagram | 
                    
                    
                    
                        | 1958. Padlock bolt schematic | 
                    
                    
                    
                        | 1959. HV cabinet door hinge definition | 
                    
                    
                    
                        | 1960. GIL1-Cabinet door hinge specification | 
                    
                    
                    
                        | 1961. GJL2 -HV cabinet door hinge specification | 
                    
                    
                    
                        | 1962. GJL4-HV cabinet door hinge specification | 
                    
                    
                    
                        | 1963. GJL5-HV cabinet door hinge specification | 
                    
                    
                    
                        | 1964. GIL7 HV cabinet door hinge specification | 
                    
                    
                    
                        | 1965. GJL9-1 HV cabinet door hinge specification | 
                    
                    
                    
                        | 1966. Mid partition assembly | 
                    
                    
                    
                        | 1967. Earthing bars and components(under-placed use) | 
                    
                    
                    
                        | 1968. Others | 
                    
                    
                    
                        | 1969. Grounding bracket assembling 5LC.1509.0201 | 
                    
                    
                    
                        | 1970. Handcart assembly | 
                    
                    
                    
                        | 1971. Fast unlocking device (5LC.1606.8010) | 
                    
                    
                    
                        | 1972. Earthing interlocking Padlock | 
                    
                    
                    
                        | 1973. Mid-door padlock | 
                    
                    
                    
                        | 1974. Second generation cabinet door hinge | 
                    
                    
                    
                        | 1975. IN-OUT indicator | 
                    
                    
                    
                        | 1976. The hydraulic transport vehicle | 
                    
                    
                    
                        | 1977. Explosion-proof frame | 
                    
                    
                    
                        | 1978. F10-8 III/LD (white aluminum silver) | 
                    
                    
                    
                        | 1979. F10-12 III/LBJ (white aluminum silver) | 
                    
                    
                    
                        | 1980. F10-12 III/LD (white aluminum silver) | 
                    
                    
                    
                        | 1981. F10-12 III/LD (gray aluminum silver) | 
                    
                    
                    
                        | 1982. F10-12 III/LD(gray aluminum gold) | 
                    
                    
                    
                        | 1983. F10-10 III/LD (white aluminum silver) | 
                    
                    
                    
                        | 1984. F10-12 III/LB (white aluminum silver) | 
                    
                    
                    
                        | 1985. F10-16 III/LD (white aluminum silver) | 
                    
                    
                    
                        | 1986. F10-12 III/LD (white aluminum silver) | 
                    
                    
                    
                        | 1987. FK10-II-22 | 
                    
                    
                    
                        | 1988. FK10-II-32 | 
                    
                    
                    
                        | 1989. FK10-II-33 | 
                    
                    
                    
                        | 1990. FK10-II-44 | 
                    
                    
                    
                        | 1991. FK10-II-55A | 
                    
                    
                    
                        | 1992. FK10-II-04 | 
                    
                    
                    
                        | 1993. FK10-II | 
                    
                    
                    
                        | 1994. FK10-I-口口 | 
                    
                    
                    
                        | 1995. Auxiliary Switch | 
                    
                    
                    
                        | 1996. EZ-300 | 
                    
                    
                    
                        | 1997. EZ-400 | 
                    
                    
                    
                        | 1998. EZ-60UNV | 
                    
                    
                    
                        | 1999. HT-51 | 
                    
                    
                    
                        | 2000. HT-60UNV | 
                    
                    
                    
                        | 2001. HT-300 | 
                    
                    
                    
                        | 2002. HT-12030 | 
                    
                    
                    
                        | 2003. HT-12032 | 
                    
                    
                    
                        | 2004. HT-400 | 
                    
                    
                    
                        | 2005. EP-610 | 
                    
                    
                    
                        | 2006. EP-510 | 
                    
                    
                    
                        | 2007. EP-410 | 
                    
                    
                    
                        | 2008. EP-430 | 
                    
                    
                    
                        | 2009. CP0-400 | 
                    
                    
                    
                        | 2010. KYQ-400 | 
                    
                    
                    
                        | 2011. CY0-400 | 
                    
                    
                    
                        | 2012. KYQ-300 | 
                    
                    
                    
                        | 2013. KYQ-300C | 
                    
                    
                    
                        | 2014. CP0-240A | 
                    
                    
                    
                        | 2015. CP0-300B | 
                    
                    
                    
                        | 2016. CP0-200A | 
                    
                    
                    
                        | 2017. CP0-150A | 
                    
                    
                    
                        | 2018. YQK-120/240/300 | 
                    
                    
                    
                        | 2019. YQK-70 | 
                    
                    
                    
                        | 2020. YQK-1632 | 
                    
                    
                    
                        | 2021. HGQX | 
                    
                    
                    
                        | 2022. EP-610B | 
                    
                    
                    
                        | 2023. EP-510B | 
                    
                    
                    
                        | 2024. CY0-400B | 
                    
                    
                    
                        | 2025. EP-410B | 
                    
                    
                    
                        | 2026. C0-500B | 
                    
                    
                    
                        | 2027. C0-400B | 
                    
                    
                    
                        | 2028. C0-300C | 
                    
                    
                    
                        | 2029. C0-1632B | 
                    
                    
                    
                        | 2030. C0-300B | 
                    
                    
                    
                        | 2031. CP0-200B | 
                    
                    
                    
                        | 2032. CP0-150B | 
                    
                    
                    
                        | 2033. C0-300 | 
                    
                    
                    
                        | 2034. FYQ-400/500 | 
                    
                    
                    
                        | 2035. C0-610C | 
                    
                    
                    
                        | 2036. YYQX-1 | 
                    
                    
                    
                        | 2037. C0-1000 | 
                    
                    
                    
                        | 2038. C0-630A | 
                    
                    
                    
                        | 2039. C0-630B | 
                    
                    
                    
                        | 2040. C0-100S | 
                    
                    
                    
                        | 2041. C0-200S | 
                    
                    
                    
                        | 2042. JY-0650 | 
                    
                    
                    
                        | 2043. JY-16120 | 
                    
                    
                    
                        | 2044. JY-35150 | 
                    
                    
                    
                        | 2045. MT-120 | 
                    
                    
                    
                        | 2046. KH-240 | 
                    
                    
                    
                        | 2047. CW-1632 | 
                    
                    
                    
                        | 2048. EZ-40 | 
                    
                    
                    
                        | 2049. EZ-50 | 
                    
                    
                    
                        | 2050. EZ-85 | 
                    
                    
                    
                        | 2051. EZ-85C | 
                    
                    
                    
                        | 2052. HT-40A/50A | 
                    
                    
                    
                        | 2053. CPC-20AF | 
                    
                    
                    
                        | 2054. CPC-40FR | 
                    
                    
                    
                        | 2055. CPC-50FR | 
                    
                    
                    
                        | 2056. CPC-85FR | 
                    
                    
                    
                        | 2057. CC-50A | 
                    
                    
                    
                        | 2058. YS-40A | 
                    
                    
                    
                        | 2059. CPC-40A | 
                    
                    
                    
                        | 2060. CPC-50A | 
                    
                    
                    
                        | 2061. CPC-20B | 
                    
                    
                    
                        | 2062. CPC-40B | 
                    
                    
                    
                        | 2063. CPC-50B | 
                    
                    
                    
                        | 2064. CC-50C | 
                    
                    
                    
                        | 2065. CPC-85B | 
                    
                    
                    
                        | 2066. CPC-100B | 
                    
                    
                    
                        | 2067. CPC-105C/120C | 
                    
                    
                    
                        | 2068. CPC-130A | 
                    
                    
                    
                        | 2069. CC-100L/250L/500L | 
                    
                    
                    
                        | 2070. LK-125 | 
                    
                    
                    
                        | 2071. LK-250 | 
                    
                    
                    
                        | 2072. LK-500 | 
                    
                    
                    
                        | 2073. XLJ-S-150 | 
                    
                    
                    
                        | 2074. XLJ-S-240 | 
                    
                    
                    
                        | 2075. J40 | 
                    
                    
                    
                        | 2076. J52 | 
                    
                    
                    
                        | 2077. J75 | 
                    
                    
                    
                        | 2078. J95 | 
                    
                    
                    
                        | 2079. J100 | 
                    
                    
                    
                        | 2080. J130 | 
                    
                    
                    
                        | 2081. J160 | 
                    
                    
                    
                        | 2082. J30 | 
                    
                    
                    
                        | 2083. J13 | 
                    
                    
                    
                        | 2084. J25 | 
                    
                    
                    
                        | 2085. J50 | 
                    
                    
                    
                        | 2086. CC-325 | 
                    
                    
                    
                        | 2087. J40A | 
                    
                    
                    
                        | 2088. XLJ-D-300 | 
                    
                    
                    
                        | 2089. XLJ-D-500 | 
                    
                    
                    
                        | 2090. XLJ-65A | 
                    
                    
                    
                        | 2091. XLJ-100A | 
                    
                    
                    
                        | 2092. XLJ-130A | 
                    
                    
                    
                        | 2093. BX-30 | 
                    
                    
                    
                        | 2094. SBX | 
                    
                    
                    
                        | 2095. BXQ-Z-40B | 
                    
                    
                    
                        | 2096. BXQ-F-55 | 
                    
                    
                    
                        | 2097. BX-40A | 
                    
                    
                    
                        | 2098. BX-40B | 
                    
                    
                    
                        | 2099. BX-50 | 
                    
                    
                    
                        | 2100. KBX-45 | 
                    
                    
                    
                        | 2101. KBX65 | 
                    
                    
                    
                        | 2102. XB-90 | 
                    
                    
                    
                        | 2103. GBX720 | 
                    
                    
                    
                        | 2104. EPCB-401 | 
                    
                    
                    
                        | 2105. EPCB-301 | 
                    
                    
                    
                        | 2106. EPCB-301 | 
                    
                    
                    
                        | 2107. EZ-20 | 
                    
                    
                    
                        | 2108. VHB-120 | 
                    
                    
                    
                        | 2109. CH-60 | 
                    
                    
                    
                        | 2110. CH-70 | 
                    
                    
                    
                        | 2111. CH-80 | 
                    
                    
                    
                        | 2112. CH-100 | 
                    
                    
                    
                        | 2113. SYD-35 | 
                    
                    
                    
                        | 2114. CKJ-21 | 
                    
                    
                    
                        | 2115. MHP-20 | 
                    
                    
                    
                        | 2116. CB-200A | 
                    
                    
                    
                        | 2117. CB-150D | 
                    
                    
                    
                        | 2118. CWC-150 | 
                    
                    
                    
                        | 2119. CWC-200 | 
                    
                    
                    
                        | 2120. CWC-150V/200V | 
                    
                    
                    
                        | 2121. HYB-150B | 
                    
                    
                    
                        | 2122. CAC-75/110 | 
                    
                    
                    
                        | 2123. CB-125D | 
                    
                    
                    
                        | 2124. CYK-8A/8B/15 | 
                    
                    
                    
                        | 2125. CP-180 | 
                    
                    
                    
                        | 2126. CP-600 | 
                    
                    
                    
                        | 2127. CP-700 | 
                    
                    
                    
                        | 2128. CP-700A | 
                    
                    
                    
                        | 2129. CP-700D | 
                    
                    
                    
                        | 2130. CP-700-2 | 
                    
                    
                    
                        | 2131. CP-700-A2 | 
                    
                    
                    
                        | 2132. CFP-800 | 
                    
                    
                    
                        | 2133. CFP-800B | 
                    
                    
                    
                        | 2134. CFP-700-2A | 
                    
                    
                    
                        | 2135. CFP-700 | 
                    
                    
                    
                        | 2136. CP-700L | 
                    
                    
                    
                        | 2137. ZCB-63B | 
                    
                    
                    
                        | 2138. ZCB6-5-A3 | 
                    
                    
                    
                        | 2139. HEP-8G | 
                    
                    
                    
                        | 2140. HEP-EGB | 
                    
                    
                    
                        | 2141. ZCB6-5-AC | 
                    
                    
                    
                        | 2142. ZCB6-5-AB | 
                    
                    
                    
                        | 2143. ZCB6-5-ABC | 
                    
                    
                    
                        | 2144. CTE-25AS | 
                    
                    
                    
                        | 2145. HG-700R | 
                    
                    
                    
                        | 2146. SY-2.5L | 
                    
                    
                    
                        | 2147. SYB-2.5S | 
                    
                    
                    
                        | 2148. SY-10G | 
                    
                    
                    
                        | 2149. SYB-2.5T | 
                    
                    
                    
                        | 2150. SY-25G | 
                    
                    
                    
                        | 2151. DSY-60 | 
                    
                    
                    
                        | 2152. HP-12 | 
                    
                    
                    
                        | 2153. HP-16 | 
                    
                    
                    
                        | 2154. HP-22 | 
                    
                    
                    
                        | 2155. HP-25/27 | 
                    
                    
                    
                        | 2156. CPC-16 | 
                    
                    
                    
                        | 2157. CPC-22 | 
                    
                    
                    
                        | 2158. CPC-25/27 | 
                    
                    
                    
                        | 2159. CPC-32 | 
                    
                    
                    
                        | 2160. EZ-MM36 | 
                    
                    
                    
                        | 2161. EZ-MM36S | 
                    
                    
                    
                        | 2162. FSH-14 | 
                    
                    
                    
                        | 2163. YP-24 | 
                    
                    
                    
                        | 2164. YP-24A | 
                    
                    
                    
                        | 2165. YP-24B | 
                    
                    
                    
                        | 2166. FS-538/1054 | 
                    
                    
                    
                        | 2167. RC-16 | 
                    
                    
                    
                        | 2168. NRC-20 | 
                    
                    
                    
                        | 2169. RC-20 | 
                    
                    
                    
                        | 2170. RC-22 | 
                    
                    
                    
                        | 2171. RC-25 | 
                    
                    
                    
                        | 2172. RC-32 | 
                    
                    
                    
                        | 2173. RB-16 | 
                    
                    
                    
                        | 2174. HGW-22 | 
                    
                    
                    
                        | 2175. HGW-22A | 
                    
                    
                    
                        | 2176. SWG-25S | 
                    
                    
                    
                        | 2177. CPB-1/2/3/4/5 | 
                    
                    
                    
                        | 2178. SWG-25/1/2/3/4/5 | 
                    
                    
                    
                        | 2179. YL-5T/10T/15T/20T/30T/50T | 
                    
                    
                    
                        | 2180. FYL-5T/10T/15T/20T/30T/50T/100T/150T | 
                    
                    
                    
                        | 2181. FPY-Super thin single acting hydraulic steel cylinder | 
                    
                    
                    
                        | 2182. DFPY-Multistage hydraulic steel cylinder | 
                    
                    
                    
                        | 2183. RSC-Single Hydraulic Cylinder | 
                    
                    
                    
                        | 2184. FCY-Single Hydraulic Cylinder | 
                    
                    
                    
                        | 2185. FCY-Double-acting Hydraulic Cylinder | 
                    
                    
                    
                        | 2186. RSC-Hollow Plunger Cylinder | 
                    
                    
                    
                        | 2187. CW-1632 | 
                    
                    
                    
                        | 2188. YQK-1632 | 
                    
                    
                    
                        | 2189. C0-1632B | 
                    
                    
                    
                        | 2190. HGYG-1550B | 
                    
                    
                    
                        | 2191. EZ-300 | 
                    
                    
                    
                        | 2192. EZ-1550 | 
                    
                    
                    
                        | 2193. CW-18 | 
                    
                    
                    
                        | 2194. CW-24 | 
                    
                    
                    
                        | 2195. CW-1824 | 
                    
                    
                    
                        | 2196. SSC-T | 
                    
                    
                    
                        | 2197. PEX-1632E | 
                    
                    
                    
                        | 2198. XP-1632 | 
                    
                    
                    
                        | 2199. HGYG-1525 | 
                    
                    
                    
                        | 2200. HGYG-1525B | 
                    
                    
                    
                        | 2201. HGYG-3250B | 
                    
                    
                    
                        | 2202. HGYG-65100B | 
                    
                    
                    
                        | 2203. SCY-45/50/54/57/60 | 
                    
                    
                    
                        | 2204. 滑轮 | 
                    
                    
                    
                        | 2205. 卡线器 | 
                    
                    
                    
                        | 2206. 分油器 | 
                    
                    
                    
                        | 2207. 3/8"NPT快速接头 | 
                    
                    
                    
                        | 2208. 直插快速接头 | 
                    
                    
                    
                        | 2209. H型C型线夹压接模(适用于ep-510/610) | 
                    
                    
                    
                        | 2210. 冲孔模具 | 
                    
                    
                    
                        | 2211. 油管 | 
                    
                    
                    
                        | 2212. 换向阀 | 
                    
                    
                    
                        | 2213. What Is Cylinder components? | 
                    
                    
                    
                        | 2214. The main structure of load switch? | 
                    
                    
                    
                        | 2215. Use and importance of bolts and nuts |